Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References enzymes (2) Show 2 proteins XML

Show more...Show more...Show more...Show more...

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2006-08-12 19:14:46 UTC

Update Date

2021-09-14 15:48:15 UTC

HMDB ID

HMDB0003351

Secondary Accession Numbers

HMDB03351

Metabolite Identification

Common Name

GDP-glucose

Description

GDP-glucose, also known as (GDP-GLC)1 or GDP-D-glucose, belongs to the class of organic compounds known as purine nucleotide sugars. These are purine nucleotides bound to a saccharide derivative through the terminal phosphate group. GDP-glucose is an extremely weak basic (essentially neutral) compound (based on its pKa).

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

  Mrv1652306302020252D          

 39 42  0  0  0  0            999 V2000
 9997.4509 9997.8324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 9999.2426 9997.8241    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 9999.7511 9999.6854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
10000.4660 9999.2734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10001.1827 9999.6854    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
10002.0976 9999.1627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10000.769610000.4019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10001.595710000.4019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10003.0106 9999.6875    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
10003.7252 9999.2775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10002.599510000.4061    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10003.425710000.4061    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10005.1565 9998.4514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10005.156510001.7548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
10006.5879 9999.2775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10005.873210002.1658    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10006.587910000.9286    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 9998.3633 9999.7670    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 9997.9508 9998.4974    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
 9998.7758 9998.4974    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
 9999.0307 9999.2820    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
10005.157210000.9264    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
10004.442710000.5139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10004.4427 9999.6888    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
10005.1572 9999.2764    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
10005.8717 9999.6888    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
10005.871710000.5139    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
 9994.8687 9999.7961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 9994.6137 9999.0115    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 9995.1658 9998.3983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 9995.9727 9998.5700    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 9996.2278 9999.3545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 9995.6757 9999.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 9996.9814 9999.6900    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 9996.895310000.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 9996.088310000.6821    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 9994.316610000.4092    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 9994.9109 9997.6137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 9997.6958 9999.2774    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
  3  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  5  7  2  0  0  0  0
  5  8  1  0  0  0  0
  6  9  1  0  0  0  0
  9 10  1  0  0  0  0
  9 11  2  0  0  0  0
  9 12  1  0  0  0  0
 14 16  1  0  0  0  0
 19 20  1  0  0  0  0
 20 21  1  0  0  0  0
 18 21  1  0  0  0  0
 19  1  1  1  0  0  0
 20  2  1  1  0  0  0
 21  3  1  6  0  0  0
 22 27  1  0  0  0  0
 24 25  1  0  0  0  0
 25 26  1  0  0  0  0
 26 27  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  1  0  0  0  0
 24 10  1  1  0  0  0
 25 13  1  1  0  0  0
 22 14  1  6  0  0  0
 26 15  1  6  0  0  0
 27 17  1  1  0  0  0
 28 33  1  0  0  0  0
 32 33  2  0  0  0  0
 35 36  2  0  0  0  0
 33 36  1  0  0  0  0
 34 35  1  0  0  0  0
 32 34  1  0  0  0  0
 28 29  1  0  0  0  0
 29 30  1  0  0  0  0
 30 31  2  0  0  0  0
 31 32  1  0  0  0  0
 30 38  1  0  0  0  0
 39 34  1  6  0  0  0
 28 37  2  0  0  0  0
 39 19  1  0  0  0  0
 18 39  1  0  0  0  0
M  END

HMDB0003351
     RDKit          3D
GDP-glucose
 64 67  0  0  0  0  0  0  0  0999 V2000
    9.5928   -0.5174    1.6974 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8489   -0.1833    0.5233 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5136   -0.2484    0.4784 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7976    0.0641   -0.6237 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4623    0.4683   -1.7548 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5134    0.7087   -2.6760 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2976    0.4699   -2.1601 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4614    0.0713   -0.8932 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4725   -0.2968    0.0658 C   0  0  2  0  0  0  0  0  0  0  0  0
    3.3401   -0.9013   -0.5253 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4325   -0.9783    0.5072 C   0  0  2  0  0  0  0  0  0  0  0  0
    1.0002   -1.0181    0.0594 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6393    0.1119   -0.6688 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9838   -0.0392   -1.1190 P   0  0  0  0  0  5  0  0  0  0  0  0
   -1.0759    0.1316   -2.6376 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9087    1.2287   -0.4595 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6234   -1.5309   -0.7215 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7395   -1.4787    0.5226 P   0  0  0  0  0  5  0  0  0  0  0  0
   -2.2573   -0.4563    1.5529 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8019   -2.9662    1.3406 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2980   -1.1043   -0.0048 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8950   -0.2373    0.9009 C   0  0  1  0  0  0  0  0  0  0  0  0
   -5.0888    0.9674    0.2455 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0986    0.8535   -0.6934 C   0  0  2  0  0  0  0  0  0  0  0  0
   -6.0789    1.9849   -1.6960 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0874    1.8685   -2.6301 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3968    0.8213    0.0869 C   0  0  1  0  0  0  0  0  0  0  0  0
   -8.5074    0.8868   -0.7356 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4061   -0.4475    0.8847 C   0  0  2  0  0  0  0  0  0  0  0  0
   -8.4437   -0.3223    1.8338 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1270   -0.7997    1.5284 C   0  0  1  0  0  0  0  0  0  0  0  0
   -5.9949   -2.2084    1.4894 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6149    0.2363    1.3777 C   0  0  1  0  0  0  0  0  0  0  0  0
    3.0606   -0.1934    2.6287 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8022    0.9215    0.7124 C   0  0  1  0  0  0  0  0  0  0  0  0
    4.6267    1.5524    1.6097 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8501    0.5411   -1.7239 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4334    0.9120   -2.7665 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4896    0.2138   -0.5900 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2422   -1.2059    2.3878 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.4989   -0.0632    1.8617 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3526    0.5767   -2.6664 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8742   -0.9284    0.8783 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6279   -1.9209    1.0639 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8408   -1.9326   -0.5491 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3685   -1.0328    0.9717 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3168    1.8406    0.0697 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9253   -3.4345    1.1820 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1653   -0.0453    1.7100 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9786   -0.1345   -1.1781 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1135    1.8988   -2.2484 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0528    2.9714   -1.1962 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8640    1.2631   -3.3676 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3414    1.6827    0.8037 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8769    1.8217   -0.6460 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7587   -1.2616    0.1890 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4050   -1.1877    2.3505 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1845   -0.5536    2.6200 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0278   -2.4894    0.5218 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7371    0.8823    1.4348 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3516   -0.1760    3.3097 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3861    1.5808   -0.0643 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7612    2.4908    1.2789 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.5327    0.2715   -0.5761 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 14 16  1  0
 14 17  1  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 24 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 11 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
  5 37  1  0
 37 38  2  0
 37 39  1  0
 39  2  1  0
  8  4  1  0
 35  9  1  0
 31 22  1  0
  1 40  1  0
  1 41  1  0
  7 42  1  0
  9 43  1  1
 11 44  1  1
 12 45  1  0
 12 46  1  0
 16 47  1  0
 20 48  1  0
 22 49  1  1
 24 50  1  6
 25 51  1  0
 25 52  1  0
 26 53  1  0
 27 54  1  1
 28 55  1  0
 29 56  1  6
 30 57  1  0
 31 58  1  1
 32 59  1  0
 33 60  1  1
 34 61  1  0
 35 62  1  6
 36 63  1  0
 39 64  1  0
M  END

  Mrv1652306302020252D          

 39 42  0  0  0  0            999 V2000
 9997.4509 9997.8324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 9999.2426 9997.8241    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 9999.7511 9999.6854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
10000.4660 9999.2734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10001.1827 9999.6854    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
10002.0976 9999.1627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10000.769610000.4019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10001.595710000.4019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10003.0106 9999.6875    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
10003.7252 9999.2775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10002.599510000.4061    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10003.425710000.4061    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10005.1565 9998.4514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10005.156510001.7548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
10006.5879 9999.2775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10005.873210002.1658    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10006.587910000.9286    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 9998.3633 9999.7670    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 9997.9508 9998.4974    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
 9998.7758 9998.4974    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
 9999.0307 9999.2820    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
10005.157210000.9264    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
10004.442710000.5139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
10004.4427 9999.6888    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
10005.1572 9999.2764    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
10005.8717 9999.6888    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
10005.871710000.5139    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
 9994.8687 9999.7961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 9994.6137 9999.0115    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 9995.1658 9998.3983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 9995.9727 9998.5700    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 9996.2278 9999.3545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 9995.6757 9999.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 9996.9814 9999.6900    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 9996.895310000.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 9996.088310000.6821    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 9994.316610000.4092    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 9994.9109 9997.6137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 9997.6958 9999.2774    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
  3  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  5  7  2  0  0  0  0
  5  8  1  0  0  0  0
  6  9  1  0  0  0  0
  9 10  1  0  0  0  0
  9 11  2  0  0  0  0
  9 12  1  0  0  0  0
 14 16  1  0  0  0  0
 19 20  1  0  0  0  0
 20 21  1  0  0  0  0
 18 21  1  0  0  0  0
 19  1  1  1  0  0  0
 20  2  1  1  0  0  0
 21  3  1  6  0  0  0
 22 27  1  0  0  0  0
 24 25  1  0  0  0  0
 25 26  1  0  0  0  0
 26 27  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  1  0  0  0  0
 24 10  1  1  0  0  0
 25 13  1  1  0  0  0
 22 14  1  6  0  0  0
 26 15  1  6  0  0  0
 27 17  1  1  0  0  0
 28 33  1  0  0  0  0
 32 33  2  0  0  0  0
 35 36  2  0  0  0  0
 33 36  1  0  0  0  0
 34 35  1  0  0  0  0
 32 34  1  0  0  0  0
 28 29  1  0  0  0  0
 29 30  1  0  0  0  0
 30 31  2  0  0  0  0
 31 32  1  0  0  0  0
 30 38  1  0  0  0  0
 39 34  1  6  0  0  0
 28 37  2  0  0  0  0
 39 19  1  0  0  0  0
 18 39  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0003351

> <DATABASE_NAME>
hmdb

> <SMILES>
NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(O)(=O)OP(O)(=O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)N1

> <INCHI_IDENTIFIER>
InChI=1S/C16H25N5O16P2/c17-16-19-12-6(13(28)20-16)18-3-21(12)14-10(26)8(24)5(34-14)2-33-38(29,30)37-39(31,32)36-15-11(27)9(25)7(23)4(1-22)35-15/h3-5,7-11,14-15,22-27H,1-2H2,(H,29,30)(H,31,32)(H3,17,19,20,28)/t4-,5-,7-,8-,9+,10-,11-,14-,15-/m1/s1

> <INCHI_KEY>
MVMSCBBUIHUTGJ-LRJDVEEWSA-N

> <FORMULA>
C16H25N5O16P2

> <MOLECULAR_WEIGHT>
605.3411

> <EXACT_MASS>
605.077152801

> <JCHEM_ACCEPTOR_COUNT>
16

> <JCHEM_ATOM_COUNT>
64

> <JCHEM_AVERAGE_POLARIZABILITY>
48.04960643089578

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
10

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
[({[(2R,3S,4R,5R)-5-(2-amino-6-oxo-6,9-dihydro-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]({[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy})phosphinic acid

> <ALOGPS_LOGP>
-1.76

> <JCHEM_LOGP>
-5.287584132999999

> <ALOGPS_LOGS>
-1.89

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
4

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-2

> <JCHEM_PKA>
3.176324364365109

> <JCHEM_PKA_STRONGEST_ACIDIC>
1.7325998238285534

> <JCHEM_PKA_STRONGEST_BASIC>
-3.6484093801081894

> <JCHEM_POLAR_SURFACE_AREA>
327.4299999999999

> <JCHEM_REFRACTIVITY>
118.51129999999996

> <JCHEM_ROTATABLE_BOND_COUNT>
9

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
7.77e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
gdp-α-D-glucose

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0003351
     RDKit          3D
GDP-glucose
 64 67  0  0  0  0  0  0  0  0999 V2000
    9.5928   -0.5174    1.6974 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8489   -0.1833    0.5233 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5136   -0.2484    0.4784 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7976    0.0641   -0.6237 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4623    0.4683   -1.7548 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5134    0.7087   -2.6760 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2976    0.4699   -2.1601 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4614    0.0713   -0.8932 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4725   -0.2968    0.0658 C   0  0  2  0  0  0  0  0  0  0  0  0
    3.3401   -0.9013   -0.5253 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4325   -0.9783    0.5072 C   0  0  2  0  0  0  0  0  0  0  0  0
    1.0002   -1.0181    0.0594 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6393    0.1119   -0.6688 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9838   -0.0392   -1.1190 P   0  0  0  0  0  5  0  0  0  0  0  0
   -1.0759    0.1316   -2.6376 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9087    1.2287   -0.4595 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6234   -1.5309   -0.7215 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7395   -1.4787    0.5226 P   0  0  0  0  0  5  0  0  0  0  0  0
   -2.2573   -0.4563    1.5529 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8019   -2.9662    1.3406 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2980   -1.1043   -0.0048 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8950   -0.2373    0.9009 C   0  0  1  0  0  0  0  0  0  0  0  0
   -5.0888    0.9674    0.2455 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0986    0.8535   -0.6934 C   0  0  2  0  0  0  0  0  0  0  0  0
   -6.0789    1.9849   -1.6960 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0874    1.8685   -2.6301 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3968    0.8213    0.0869 C   0  0  1  0  0  0  0  0  0  0  0  0
   -8.5074    0.8868   -0.7356 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4061   -0.4475    0.8847 C   0  0  2  0  0  0  0  0  0  0  0  0
   -8.4437   -0.3223    1.8338 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1270   -0.7997    1.5284 C   0  0  1  0  0  0  0  0  0  0  0  0
   -5.9949   -2.2084    1.4894 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6149    0.2363    1.3777 C   0  0  1  0  0  0  0  0  0  0  0  0
    3.0606   -0.1934    2.6287 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8022    0.9215    0.7124 C   0  0  1  0  0  0  0  0  0  0  0  0
    4.6267    1.5524    1.6097 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8501    0.5411   -1.7239 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4334    0.9120   -2.7665 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4896    0.2138   -0.5900 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2422   -1.2059    2.3878 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.4989   -0.0632    1.8617 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3526    0.5767   -2.6664 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8742   -0.9284    0.8783 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6279   -1.9209    1.0639 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8408   -1.9326   -0.5491 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3685   -1.0328    0.9717 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3168    1.8406    0.0697 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9253   -3.4345    1.1820 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1653   -0.0453    1.7100 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9786   -0.1345   -1.1781 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1135    1.8988   -2.2484 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0528    2.9714   -1.1962 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8640    1.2631   -3.3676 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3414    1.6827    0.8037 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8769    1.8217   -0.6460 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7587   -1.2616    0.1890 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4050   -1.1877    2.3505 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1845   -0.5536    2.6200 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0278   -2.4894    0.5218 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7371    0.8823    1.4348 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3516   -0.1760    3.3097 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3861    1.5808   -0.0643 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7612    2.4908    1.2789 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.5327    0.2715   -0.5761 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 14 16  1  0
 14 17  1  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 24 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 11 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
  5 37  1  0
 37 38  2  0
 37 39  1  0
 39  2  1  0
  8  4  1  0
 35  9  1  0
 31 22  1  0
  1 40  1  0
  1 41  1  0
  7 42  1  0
  9 43  1  1
 11 44  1  1
 12 45  1  0
 12 46  1  0
 16 47  1  0
 20 48  1  0
 22 49  1  1
 24 50  1  6
 25 51  1  0
 25 52  1  0
 26 53  1  0
 27 54  1  1
 28 55  1  0
 29 56  1  6
 30 57  1  0
 31 58  1  1
 32 59  1  0
 33 60  1  1
 34 61  1  0
 35 62  1  6
 36 63  1  0
 39 64  1  0
M  END

HEADER    PROTEIN                                 30-JUN-20   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   30-JUN-20         0                                  
HETATM    1  O   UNK     0    8661.9088662.620   0.000  0.00  0.00           O+0
HETATM    2  O   UNK     0    8665.2538662.605   0.000  0.00  0.00           O+0
HETATM    3  C   UNK     0    8666.2028666.079   0.000  0.00  0.00           C+0
HETATM    4  O   UNK     0    8667.5378665.310   0.000  0.00  0.00           O+0
HETATM    5  P   UNK     0    8668.8748666.079   0.000  0.00  0.00           P+0
HETATM    6  O   UNK     0    8670.5828665.104   0.000  0.00  0.00           O+0
HETATM    7  O   UNK     0    8668.1038667.417   0.000  0.00  0.00           O+0
HETATM    8  O   UNK     0    8669.6458667.417   0.000  0.00  0.00           O+0
HETATM    9  P   UNK     0    8672.2868666.083   0.000  0.00  0.00           P+0
HETATM   10  O   UNK     0    8673.6208665.318   0.000  0.00  0.00           O+0
HETATM   11  O   UNK     0    8671.5198667.425   0.000  0.00  0.00           O+0
HETATM   12  O   UNK     0    8673.0618667.425   0.000  0.00  0.00           O+0
HETATM   13  O   UNK     0    8676.2928663.776   0.000  0.00  0.00           O+0
HETATM   14  C   UNK     0    8676.2928669.942   0.000  0.00  0.00           C+0
HETATM   15  O   UNK     0    8678.9648665.318   0.000  0.00  0.00           O+0
HETATM   16  O   UNK     0    8677.6308670.709   0.000  0.00  0.00           O+0
HETATM   17  O   UNK     0    8678.9648668.400   0.000  0.00  0.00           O+0
HETATM   18  O   UNK     0    8663.6118666.232   0.000  0.00  0.00           O+0
HETATM   19  C   UNK     0    8662.8418663.862   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0    8664.3818663.862   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0    8664.8578665.326   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0    8676.2938668.396   0.000  0.00  0.00           C+0
HETATM   23  O   UNK     0    8674.9608667.626   0.000  0.00  0.00           O+0
HETATM   24  C   UNK     0    8674.9608666.086   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0    8676.2938665.316   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0    8677.6278666.086   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0    8677.6278667.626   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0    8657.0888666.286   0.000  0.00  0.00           C+0
HETATM   29  N   UNK     0    8656.6128664.821   0.000  0.00  0.00           N+0
HETATM   30  C   UNK     0    8657.6438663.677   0.000  0.00  0.00           C+0
HETATM   31  N   UNK     0    8659.1498663.997   0.000  0.00  0.00           N+0
HETATM   32  C   UNK     0    8659.6258665.462   0.000  0.00  0.00           C+0
HETATM   33  C   UNK     0    8658.5958666.606   0.000  0.00  0.00           C+0
HETATM   34  N   UNK     0    8661.0328666.088   0.000  0.00  0.00           N+0
HETATM   35  C   UNK     0    8660.8718667.620   0.000  0.00  0.00           C+0
HETATM   36  N   UNK     0    8659.3658667.940   0.000  0.00  0.00           N+0
HETATM   37  O   UNK     0    8656.0588667.431   0.000  0.00  0.00           O+0
HETATM   38  N   UNK     0    8657.1678662.212   0.000  0.00  0.00           N+0
HETATM   39  C   UNK     0    8662.3658665.318   0.000  0.00  0.00           C+0
CONECT    1   19                                                            
CONECT    2   20                                                            
CONECT    3    4   21                                                       
CONECT    4    3    5                                                       
CONECT    5    4    6    7    8                                             
CONECT    6    5    9                                                       
CONECT    7    5                                                            
CONECT    8    5                                                            
CONECT    9    6   10   11   12                                             
CONECT   10    9   24                                                       
CONECT   11    9                                                            
CONECT   12    9                                                            
CONECT   13   25                                                            
CONECT   14   16   22                                                       
CONECT   15   26                                                            
CONECT   16   14                                                            
CONECT   17   27                                                            
CONECT   18   21   39                                                       
CONECT   19   20    1   39                                                  
CONECT   20   19   21    2                                                  
CONECT   21   20   18    3                                                  
CONECT   22   27   23   14                                                  
CONECT   23   22   24                                                       
CONECT   24   25   23   10                                                  
CONECT   25   24   26   13                                                  
CONECT   26   25   27   15                                                  
CONECT   27   22   26   17                                                  
CONECT   28   33   29   37                                                  
CONECT   29   28   30                                                       
CONECT   30   29   31   38                                                  
CONECT   31   30   32                                                       
CONECT   32   33   34   31                                                  
CONECT   33   28   32   36                                                  
CONECT   34   35   32   39                                                  
CONECT   35   36   34                                                       
CONECT   36   35   33                                                       
CONECT   37   28                                                            
CONECT   38   30                                                            
CONECT   39   34   19   18                                                  
MASTER        0    0    0    0    0    0    0    0   39    0   84    0
END

COMPND    HMDB0003351
HETATM    1  N1  UNL     1       9.593  -0.517   1.697  1.00  0.00           N  
HETATM    2  C1  UNL     1       8.849  -0.183   0.523  1.00  0.00           C  
HETATM    3  N2  UNL     1       7.514  -0.248   0.478  1.00  0.00           N  
HETATM    4  C2  UNL     1       6.798   0.064  -0.624  1.00  0.00           C  
HETATM    5  C3  UNL     1       7.462   0.468  -1.755  1.00  0.00           C  
HETATM    6  N3  UNL     1       6.513   0.709  -2.676  1.00  0.00           N  
HETATM    7  C4  UNL     1       5.298   0.470  -2.160  1.00  0.00           C  
HETATM    8  N4  UNL     1       5.461   0.071  -0.893  1.00  0.00           N  
HETATM    9  C5  UNL     1       4.472  -0.297   0.066  1.00  0.00           C  
HETATM   10  O1  UNL     1       3.340  -0.901  -0.525  1.00  0.00           O  
HETATM   11  C6  UNL     1       2.432  -0.978   0.507  1.00  0.00           C  
HETATM   12  C7  UNL     1       1.000  -1.018   0.059  1.00  0.00           C  
HETATM   13  O2  UNL     1       0.639   0.112  -0.669  1.00  0.00           O  
HETATM   14  P1  UNL     1      -0.984  -0.039  -1.119  1.00  0.00           P  
HETATM   15  O3  UNL     1      -1.076   0.132  -2.638  1.00  0.00           O  
HETATM   16  O4  UNL     1      -1.909   1.229  -0.459  1.00  0.00           O  
HETATM   17  O5  UNL     1      -1.623  -1.531  -0.722  1.00  0.00           O  
HETATM   18  P2  UNL     1      -2.740  -1.479   0.523  1.00  0.00           P  
HETATM   19  O6  UNL     1      -2.257  -0.456   1.553  1.00  0.00           O  
HETATM   20  O7  UNL     1      -2.802  -2.966   1.341  1.00  0.00           O  
HETATM   21  O8  UNL     1      -4.298  -1.104  -0.005  1.00  0.00           O  
HETATM   22  C8  UNL     1      -4.895  -0.237   0.901  1.00  0.00           C  
HETATM   23  O9  UNL     1      -5.089   0.967   0.245  1.00  0.00           O  
HETATM   24  C9  UNL     1      -6.099   0.853  -0.693  1.00  0.00           C  
HETATM   25  C10 UNL     1      -6.079   1.985  -1.696  1.00  0.00           C  
HETATM   26  O10 UNL     1      -7.087   1.868  -2.630  1.00  0.00           O  
HETATM   27  C11 UNL     1      -7.397   0.821   0.087  1.00  0.00           C  
HETATM   28  O11 UNL     1      -8.507   0.887  -0.736  1.00  0.00           O  
HETATM   29  C12 UNL     1      -7.406  -0.448   0.885  1.00  0.00           C  
HETATM   30  O12 UNL     1      -8.444  -0.322   1.834  1.00  0.00           O  
HETATM   31  C13 UNL     1      -6.127  -0.800   1.528  1.00  0.00           C  
HETATM   32  O13 UNL     1      -5.995  -2.208   1.489  1.00  0.00           O  
HETATM   33  C14 UNL     1       2.615   0.236   1.378  1.00  0.00           C  
HETATM   34  O14 UNL     1       3.061  -0.193   2.629  1.00  0.00           O  
HETATM   35  C15 UNL     1       3.802   0.922   0.712  1.00  0.00           C  
HETATM   36  O15 UNL     1       4.627   1.552   1.610  1.00  0.00           O  
HETATM   37  C16 UNL     1       8.850   0.541  -1.724  1.00  0.00           C  
HETATM   38  O16 UNL     1       9.433   0.912  -2.767  1.00  0.00           O  
HETATM   39  N5  UNL     1       9.490   0.214  -0.590  1.00  0.00           N  
HETATM   40  H1  UNL     1       9.242  -1.206   2.388  1.00  0.00           H  
HETATM   41  H2  UNL     1      10.499  -0.063   1.862  1.00  0.00           H  
HETATM   42  H3  UNL     1       4.353   0.577  -2.666  1.00  0.00           H  
HETATM   43  H4  UNL     1       4.874  -0.928   0.878  1.00  0.00           H  
HETATM   44  H5  UNL     1       2.628  -1.921   1.064  1.00  0.00           H  
HETATM   45  H6  UNL     1       0.841  -1.933  -0.549  1.00  0.00           H  
HETATM   46  H7  UNL     1       0.369  -1.033   0.972  1.00  0.00           H  
HETATM   47  H8  UNL     1      -1.317   1.841   0.070  1.00  0.00           H  
HETATM   48  H9  UNL     1      -1.925  -3.434   1.182  1.00  0.00           H  
HETATM   49  H10 UNL     1      -4.165  -0.045   1.710  1.00  0.00           H  
HETATM   50  H11 UNL     1      -5.979  -0.134  -1.178  1.00  0.00           H  
HETATM   51  H12 UNL     1      -5.113   1.899  -2.248  1.00  0.00           H  
HETATM   52  H13 UNL     1      -6.053   2.971  -1.196  1.00  0.00           H  
HETATM   53  H14 UNL     1      -6.864   1.263  -3.368  1.00  0.00           H  
HETATM   54  H15 UNL     1      -7.341   1.683   0.804  1.00  0.00           H  
HETATM   55  H16 UNL     1      -8.877   1.822  -0.646  1.00  0.00           H  
HETATM   56  H17 UNL     1      -7.759  -1.262   0.189  1.00  0.00           H  
HETATM   57  H18 UNL     1      -8.405  -1.188   2.351  1.00  0.00           H  
HETATM   58  H19 UNL     1      -6.184  -0.554   2.620  1.00  0.00           H  
HETATM   59  H20 UNL     1      -6.028  -2.489   0.522  1.00  0.00           H  
HETATM   60  H21 UNL     1       1.737   0.882   1.435  1.00  0.00           H  
HETATM   61  H22 UNL     1       2.352  -0.176   3.310  1.00  0.00           H  
HETATM   62  H23 UNL     1       3.386   1.581  -0.064  1.00  0.00           H  
HETATM   63  H24 UNL     1       4.761   2.491   1.279  1.00  0.00           H  
HETATM   64  H25 UNL     1      10.533   0.272  -0.576  1.00  0.00           H  
CONECT    1    2   40   41
CONECT    2    3    3   39
CONECT    3    4
CONECT    4    5    5    8
CONECT    5    6   37
CONECT    6    7    7
CONECT    7    8   42
CONECT    8    9
CONECT    9   10   35   43
CONECT   10   11
CONECT   11   12   33   44
CONECT   12   13   45   46
CONECT   13   14
CONECT   14   15   15   16   17
CONECT   16   47
CONECT   17   18
CONECT   18   19   19   20   21
CONECT   20   48
CONECT   21   22
CONECT   22   23   31   49
CONECT   23   24
CONECT   24   25   27   50
CONECT   25   26   51   52
CONECT   26   53
CONECT   27   28   29   54
CONECT   28   55
CONECT   29   30   31   56
CONECT   30   57
CONECT   31   32   58
CONECT   32   59
CONECT   33   34   35   60
CONECT   34   61
CONECT   35   36   62
CONECT   36   63
CONECT   37   38   38   39
CONECT   39   64
END

HMDB0003351
     RDKit          3D
GDP-glucose
 64 67  0  0  0  0  0  0  0  0999 V2000
    9.5928   -0.5174    1.6974 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8489   -0.1833    0.5233 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5136   -0.2484    0.4784 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7976    0.0641   -0.6237 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4623    0.4683   -1.7548 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5134    0.7087   -2.6760 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2976    0.4699   -2.1601 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4614    0.0713   -0.8932 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4725   -0.2968    0.0658 C   0  0  2  0  0  0  0  0  0  0  0  0
    3.3401   -0.9013   -0.5253 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4325   -0.9783    0.5072 C   0  0  2  0  0  0  0  0  0  0  0  0
    1.0002   -1.0181    0.0594 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6393    0.1119   -0.6688 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9838   -0.0392   -1.1190 P   0  0  0  0  0  5  0  0  0  0  0  0
   -1.0759    0.1316   -2.6376 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9087    1.2287   -0.4595 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6234   -1.5309   -0.7215 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7395   -1.4787    0.5226 P   0  0  0  0  0  5  0  0  0  0  0  0
   -2.2573   -0.4563    1.5529 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8019   -2.9662    1.3406 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2980   -1.1043   -0.0048 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8950   -0.2373    0.9009 C   0  0  1  0  0  0  0  0  0  0  0  0
   -5.0888    0.9674    0.2455 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0986    0.8535   -0.6934 C   0  0  2  0  0  0  0  0  0  0  0  0
   -6.0789    1.9849   -1.6960 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0874    1.8685   -2.6301 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3968    0.8213    0.0869 C   0  0  1  0  0  0  0  0  0  0  0  0
   -8.5074    0.8868   -0.7356 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4061   -0.4475    0.8847 C   0  0  2  0  0  0  0  0  0  0  0  0
   -8.4437   -0.3223    1.8338 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1270   -0.7997    1.5284 C   0  0  1  0  0  0  0  0  0  0  0  0
   -5.9949   -2.2084    1.4894 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6149    0.2363    1.3777 C   0  0  1  0  0  0  0  0  0  0  0  0
    3.0606   -0.1934    2.6287 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8022    0.9215    0.7124 C   0  0  1  0  0  0  0  0  0  0  0  0
    4.6267    1.5524    1.6097 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8501    0.5411   -1.7239 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4334    0.9120   -2.7665 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4896    0.2138   -0.5900 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2422   -1.2059    2.3878 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.4989   -0.0632    1.8617 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3526    0.5767   -2.6664 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8742   -0.9284    0.8783 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6279   -1.9209    1.0639 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8408   -1.9326   -0.5491 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3685   -1.0328    0.9717 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3168    1.8406    0.0697 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9253   -3.4345    1.1820 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1653   -0.0453    1.7100 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9786   -0.1345   -1.1781 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1135    1.8988   -2.2484 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0528    2.9714   -1.1962 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8640    1.2631   -3.3676 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3414    1.6827    0.8037 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8769    1.8217   -0.6460 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7587   -1.2616    0.1890 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4050   -1.1877    2.3505 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1845   -0.5536    2.6200 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0278   -2.4894    0.5218 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7371    0.8823    1.4348 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3516   -0.1760    3.3097 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3861    1.5808   -0.0643 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7612    2.4908    1.2789 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.5327    0.2715   -0.5761 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 14 16  1  0
 14 17  1  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 24 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 11 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
  5 37  1  0
 37 38  2  0
 37 39  1  0
 39  2  1  0
  8  4  1  0
 35  9  1  0
 31 22  1  0
  1 40  1  0
  1 41  1  0
  7 42  1  0
  9 43  1  1
 11 44  1  1
 12 45  1  0
 12 46  1  0
 16 47  1  0
 20 48  1  0
 22 49  1  1
 24 50  1  6
 25 51  1  0
 25 52  1  0
 26 53  1  0
 27 54  1  1
 28 55  1  0
 29 56  1  6
 30 57  1  0
 31 58  1  1
 32 59  1  0
 33 60  1  1
 34 61  1  0
 35 62  1  6
 36 63  1  0
 39 64  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
(GDP-GLC)1	ChEBI
GDP-D-glucose	ChEBI
GDPG	ChEBI
Guanosine diphosphate glucose	ChEBI
Guanosine diphosphoglucose	ChEBI
Guanosine diphosphoric acid glucose	Generator
GDP-alpha-D-glucose	HMDB
Guanosine 5-pyrophosphate	HMDB
P-alpha-D-Glucopyranosyl ester	HMDB
GDP Glucose	MeSH, HMDB
Guanosine diphosphate glucose, (D)-isomer	MeSH, HMDB
GDP-glucose	ChEBI
GDP-a-D-Glucose	Generator, HMDB
GDP-α-D-glucose	Generator, HMDB
Guanosine 5'-diphosphate glucose	HMDB
Guanosine 5'-diphosphate-D-glucose	HMDB
Guanosine 5’-diphosphate glucose	HMDB
Guanosine 5’-diphosphate-D-glucose	HMDB
Guanosine diphosphate D-glucose	HMDB
Guanosine 5'-(trihydrogen diphosphate), P'-a-D-glucopyranosyl ester	HMDB
Guanosine 5'-(trihydrogen diphosphate), P'-alpha-D-glucopyranosyl ester	HMDB
Guanosine 5'-(trihydrogen diphosphate), P'-α-D-glucopyranosyl ester	HMDB
Guanosine 5'-(trihydrogen diphosphoric acid), P'-a-D-glucopyranosyl ester	HMDB
Guanosine 5'-(trihydrogen diphosphoric acid), P'-alpha-D-glucopyranosyl ester	HMDB
Guanosine 5'-(trihydrogen diphosphoric acid), P'-α-D-glucopyranosyl ester	HMDB
Guanosine 5’-(trihydrogen diphosphate), P’-a-D-glucopyranosyl ester	HMDB
Guanosine 5’-(trihydrogen diphosphate), P’-α-D-glucopyranosyl ester	HMDB
Guanosine 5’-(trihydrogen diphosphoric acid), P’-a-D-glucopyranosyl ester	HMDB
Guanosine 5’-(trihydrogen diphosphoric acid), P’-α-D-glucopyranosyl ester	HMDB

Chemical Formula

C₁₆H₂₅N₅O₁₆P₂

Average Molecular Weight

605.3411

Monoisotopic Molecular Weight

605.077152801

IUPAC Name

[({[(2R,3S,4R,5R)-5-(2-amino-6-oxo-6,9-dihydro-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]({[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy})phosphinic acid

Traditional Name

gdp-α-D-glucose

CAS Registry Number

5750-57-2

SMILES

NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(O)(=O)OP(O)(=O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)N1

InChI Identifier

InChI=1S/C16H25N5O16P2/c17-16-19-12-6(13(28)20-16)18-3-21(12)14-10(26)8(24)5(34-14)2-33-38(29,30)37-39(31,32)36-15-11(27)9(25)7(23)4(1-22)35-15/h3-5,7-11,14-15,22-27H,1-2H2,(H,29,30)(H,31,32)(H3,17,19,20,28)/t4-,5-,7-,8-,9+,10-,11-,14-,15-/m1/s1

InChI Key

MVMSCBBUIHUTGJ-LRJDVEEWSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as purine nucleotide sugars. These are purine nucleotides bound to a saccharide derivative through the terminal phosphate group.

Kingdom

Organic compounds

Super Class

Nucleosides, nucleotides, and analogues

Class

Purine nucleotides

Sub Class

Purine nucleotide sugars

Direct Parent

Purine nucleotide sugars

Alternative Parents

Substituents

Purine nucleotide sugar
Purine ribonucleoside diphosphate
Purine ribonucleoside monophosphate
Pentose phosphate
Pentose-5-phosphate
Glycosyl compound
N-glycosyl compound
6-oxopurine
Hypoxanthine
Monosaccharide phosphate
Organic pyrophosphate
Imidazopyrimidine
Purine
Aminopyrimidine
Monoalkyl phosphate
Pyrimidone
Monosaccharide
N-substituted imidazole
Organic phosphoric acid derivative
Oxane
Phosphoric acid ester
Alkyl phosphate
Pyrimidine
Vinylogous amide
Tetrahydrofuran
Azole
Imidazole
Heteroaromatic compound
Secondary alcohol
Organoheterocyclic compound
Polyol
Azacycle
Oxacycle
Organopnictogen compound
Organic nitrogen compound
Alcohol
Amine
Hydrocarbon derivative
Organic oxide
Organonitrogen compound
Primary alcohol
Primary amine
Organooxygen compound
Organic oxygen compound
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

GDP-D-glucose (CHEBI:62254 )

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Cytoplasm (HMDB: HMDB0003351)

Source

Endogenous

Endogenous (HMDB: HMDB0003351)

Pheasant (FooDB: FOOD00430)
Squab (FooDB: FOOD00481)
Turkey (FooDB: FOOD00494)
Quail (FooDB: FOOD00541)
Anatidae (FooDB: FOOD00576)
Rock ptarmigan (FooDB: FOOD00597)
Columbidae (Dove, Pigeon) (FooDB: FOOD00610)
Chicken (FooDB: FOOD00329)
Mallard duck (FooDB: FOOD00353)
Emu (FooDB: FOOD00360)
Greylag goose (FooDB: FOOD00368)
Guinea hen (FooDB: FOOD00373)
Ostrich (FooDB: FOOD00422)
Velvet duck (FooDB: FOOD00427)

Lagomorph

Ovis

Sheep (Mutton, Lamb) (FooDB: FOOD00473)

Bovine

Venison

Deer (FooDB: FOOD00524)
Mule deer (FooDB: FOOD00348)
Elk (FooDB: FOOD00359)

Caprae

Domestic goat (FooDB: FOOD00529)

Swine

Domestic pig (FooDB: FOOD00536)
Wild boar (FooDB: FOOD00307)

Equine

Horse (FooDB: FOOD00378)

Process

Not Available

Role

Not Available

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Experimental Collision Cross Sections

Adduct Type	Data Source	CCS Value (Å²)	Reference
[M-H]-	MetCCS_train_neg	208.725	30932474
[M+H]+	MetCCS_train_pos	218.922	30932474
[M-H]-	Not Available	208.725	http://allccs.zhulab.cn/database/detail?ID=AllCCS00000134
[M+H]+	Not Available	219.637	http://allccs.zhulab.cn/database/detail?ID=AllCCS00000134

Predicted Molecular Properties

Property	Value	Source
Water Solubility	7.96 g/L	ALOGPS
logP	-1.8	ALOGPS
logP	-5.3	ChemAxon
logS	-1.9	ALOGPS
pKa (Strongest Acidic)	1.73	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	-2	ChemAxon
Hydrogen Acceptor Count	16	ChemAxon
Hydrogen Donor Count	10	ChemAxon
Polar Surface Area	327.43 Å²	ChemAxon
Rotatable Bond Count	9	ChemAxon
Refractivity	118.51 m³·mol⁻¹	ChemAxon
Polarizability	48.05 Å³	ChemAxon
Number of Rings	4	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	193.24	30932474
DeepCCS	[M-H]-	191.417	30932474
DeepCCS	[M-2H]-	225.351	30932474
DeepCCS	[M+Na]+	199.128	30932474
AllCCS	[M+H]+	218.6	32859911
AllCCS	[M+H-H2O]+	217.4	32859911
AllCCS	[M+NH4]+	219.6	32859911
AllCCS	[M+Na]+	219.8	32859911
AllCCS	[M-H]-	214.2	32859911
AllCCS	[M+Na-2H]-	215.4	32859911
AllCCS	[M+HCOO]-	216.8	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
GDP-glucose	NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(O)(=O)OP(O)(=O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)N1	4599.0	Standard polar	33892256
GDP-glucose	NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(O)(=O)OP(O)(=O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)N1	3306.1	Standard non polar	33892256
GDP-glucose	NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(O)(=O)OP(O)(=O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)N1	5350.0	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
GDP-glucose,1TMS,isomer #1	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O	4734.3	Semi standard non polar	33892256
GDP-glucose,1TMS,isomer #10	C[Si](C)(C)N1C(N)=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C1=O	4740.2	Semi standard non polar	33892256
GDP-glucose,1TMS,isomer #2	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@H]1O	4710.1	Semi standard non polar	33892256
GDP-glucose,1TMS,isomer #3	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H]1O	4689.9	Semi standard non polar	33892256
GDP-glucose,1TMS,isomer #4	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O	4714.4	Semi standard non polar	33892256
GDP-glucose,1TMS,isomer #5	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4739.2	Semi standard non polar	33892256
GDP-glucose,1TMS,isomer #6	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H]1N1C=NC2=C1N=C(N)[NH]C2=O	4734.4	Semi standard non polar	33892256
GDP-glucose,1TMS,isomer #7	C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O)OP(=O)(O)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O	4804.1	Semi standard non polar	33892256
GDP-glucose,1TMS,isomer #8	C[Si](C)(C)OP(=O)(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O	4814.8	Semi standard non polar	33892256
GDP-glucose,1TMS,isomer #9	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4756.7	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #1	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O	4566.8	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #10	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@H]1O	4525.5	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #11	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O	4528.6	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #12	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[C@@H]1CO	4507.9	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #13	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C	4499.9	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #14	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@H]1O	4606.2	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #15	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@H]1O	4600.4	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #16	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4619.3	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #17	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@H]1O	4602.4	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #18	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O	4487.9	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #19	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O	4492.2	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #2	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4570.1	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #20	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C	4531.1	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #21	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H]1O	4575.2	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #22	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H]1O	4563.0	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #23	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4589.3	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #24	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H]1O	4580.9	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #25	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O	4525.7	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #26	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4528.7	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #27	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O	4600.6	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #28	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O)O[Si](C)(C)C	4596.0	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #29	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4625.2	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #3	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4564.8	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #30	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O	4604.6	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #31	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O[Si](C)(C)C	4574.8	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #32	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4614.6	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #33	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4622.9	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #34	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4630.8	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #35	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O	4624.3	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #36	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H]1N1C=NC2=C1N=C(N)[NH]C2=O	4610.2	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #37	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[Si](C)(C)C)O[C@H]1N1C=NC2=C1N=C(N)[NH]C2=O	4616.8	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #38	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4633.2	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #39	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H]1N1C=NC2=C1N=C(N)N([Si](C)(C)C)C2=O	4621.1	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #4	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4519.6	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #40	C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O)OP(=O)(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)O[Si](C)(C)C	4675.3	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #41	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4690.7	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #42	C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O)OP(=O)(O)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O	4673.4	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #43	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4698.0	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #44	C[Si](C)(C)OP(=O)(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O	4692.1	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #45	C[Si](C)(C)N(C1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1)[Si](C)(C)C	4720.9	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #46	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4721.8	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #5	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4573.8	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #6	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O	4638.8	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #7	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4630.1	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #8	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4634.6	Semi standard non polar	33892256
GDP-glucose,2TMS,isomer #9	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O	4629.0	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #1	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4401.5	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #10	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4332.5	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #100	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O	4502.9	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #101	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4505.9	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #102	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O)O[Si](C)(C)C	4489.6	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #103	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O	4536.6	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #104	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4579.7	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #105	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O[Si](C)(C)C	4433.0	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #106	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O[Si](C)(C)C	4439.9	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #107	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4490.2	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #108	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O[Si](C)(C)C	4485.3	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #109	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4471.6	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #11	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4375.3	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #110	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4516.6	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #111	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O	4509.6	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #112	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4523.9	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #113	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O	4519.3	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #114	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@@H]1O	4548.4	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #115	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C	4586.2	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #116	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[Si](C)(C)C)O[C@H]1N1C=NC2=C1N=C(N)[NH]C2=O	4468.3	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #117	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4517.1	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #118	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H]1N1C=NC2=C1N=C(N)N([Si](C)(C)C)C2=O	4502.9	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #119	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4524.0	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #12	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4436.2	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #120	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[Si](C)(C)C)O[C@H]1N1C=NC2=C1N=C(N)N([Si](C)(C)C)C2=O	4512.7	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #121	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H]1N1C=NC2=C1N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C2=O	4546.8	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #122	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C	4585.3	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #123	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4572.8	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #124	C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O)OP(=O)(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)O[Si](C)(C)C	4562.4	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #125	C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O)OP(=O)(O)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O	4605.7	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #126	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4638.7	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #127	C[Si](C)(C)OP(=O)(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O	4616.4	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #128	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4650.7	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #129	C[Si](C)(C)N(C1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C)[Si](C)(C)C	4695.3	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #13	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4422.8	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #14	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4469.6	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #15	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4476.2	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #16	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	4374.2	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #17	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	4378.3	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #18	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4434.4	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #19	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4422.0	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #2	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4372.1	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #20	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4476.1	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #21	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4476.2	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #22	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4364.9	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #23	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4398.0	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #24	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4382.5	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #25	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4431.5	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #26	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4441.2	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #27	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4441.5	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #28	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4426.3	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #29	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4479.6	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #3	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4328.5	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #30	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4480.9	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #31	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4477.4	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #32	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4532.4	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #33	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O	4536.0	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #34	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4522.8	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #35	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4521.2	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #36	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O	4563.1	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #37	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4590.0	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #38	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O	4360.8	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #39	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO	4320.1	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #4	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4371.7	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #40	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C	4308.7	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #41	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@H]1O	4398.9	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #42	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@H]1O	4391.2	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #43	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4446.1	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #44	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@H]1O	4440.8	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #45	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO	4326.9	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #46	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4315.8	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #47	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O	4403.8	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #48	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1O	4395.0	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #49	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4446.5	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #5	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O	4432.4	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #50	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O	4447.5	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #51	C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C	4361.9	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #52	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[C@@H]1CO	4390.2	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #53	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@@H]1CO	4380.1	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #54	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4430.7	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #55	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[C@@H]1CO	4430.0	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #56	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C	4381.3	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #57	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C	4369.7	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #58	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4421.9	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #59	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C	4425.2	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #6	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4419.3	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #60	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@H]1O	4461.8	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #61	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4514.8	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #62	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@H]1O	4502.3	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #63	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4507.6	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #64	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@H]1O	4492.0	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #65	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@H]1O	4537.3	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #66	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4579.7	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #67	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O	4326.8	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #68	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C	4334.8	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #69	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O	4366.1	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #7	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4468.8	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #70	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H]1O	4357.7	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #71	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4412.9	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #72	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O	4417.8	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #73	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4341.3	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #74	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O	4372.4	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #75	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O	4363.3	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #76	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4411.6	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #77	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O	4423.3	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #78	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C	4406.5	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #79	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4393.0	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #8	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O	4468.8	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #80	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4445.8	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #81	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C	4443.9	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #82	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H]1O	4428.5	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #83	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4478.9	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #84	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H]1O	4478.1	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #85	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4467.9	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #86	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H]1O	4466.3	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #87	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H]1O	4500.5	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #88	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4554.7	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #89	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4370.6	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #9	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4375.9	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #90	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O	4399.0	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #91	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O)O[Si](C)(C)C	4391.7	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #92	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4447.5	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #93	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O	4439.6	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #94	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4395.9	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #95	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4404.2	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #96	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4448.1	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #97	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O	4446.4	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #98	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O)O[Si](C)(C)C	4456.3	Semi standard non polar	33892256
GDP-glucose,3TMS,isomer #99	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4513.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #1	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4273.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #10	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4290.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #100	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO	4265.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #101	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)O[C@@H]1CO	4255.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #102	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4310.7	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #103	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO	4338.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #104	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C	4262.5	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #105	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C	4252.5	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #106	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4308.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #107	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C	4330.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #108	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@H]1O	4302.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #109	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4374.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #11	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4276.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #110	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@H]1O	4393.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #111	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4365.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #112	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@H]1O	4383.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #113	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@H]1O	4399.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #114	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C	4452.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #115	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4268.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #116	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO	4270.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #117	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H]1CO	4261.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #118	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4314.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #119	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO	4351.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #12	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4334.7	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #120	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4258.5	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #121	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4267.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #122	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4312.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #123	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O	4343.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #124	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1O	4312.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #125	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4378.7	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #126	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O	4408.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #127	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4368.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #128	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1O	4397.7	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #129	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O	4405.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #13	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4358.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #130	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C	4454.5	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #131	C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C	4304.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #132	C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4294.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #133	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4348.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #134	C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C	4365.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #135	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@@H]1CO	4303.5	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #136	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4362.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #137	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[C@@H]1CO	4393.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #138	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4353.7	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #139	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O[C@@H]1CO	4381.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #14	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4252.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #140	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[C@@H]1CO	4392.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #141	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4437.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #142	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C	4301.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #143	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4363.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #144	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C	4386.5	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #145	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4351.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #146	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C	4375.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #147	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C	4390.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #148	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4434.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #149	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4422.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #15	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4267.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #150	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@H]1O	4434.7	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #151	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@H]1O	4459.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #152	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4505.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #153	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@H]1O	4446.5	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #154	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4495.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #155	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@H]1O	4523.5	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #156	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4265.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #157	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O	4276.7	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #158	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O	4263.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #159	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4323.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #16	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4254.7	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #160	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O	4364.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #161	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C	4280.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #162	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4269.7	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #163	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4322.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #164	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C	4349.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #165	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H]1O	4288.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #166	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4357.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #167	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O	4384.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #168	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4343.7	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #169	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H]1O	4372.7	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #17	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4311.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #170	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O	4374.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #171	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C	4434.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #172	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4275.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #173	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4286.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #174	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4326.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #175	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O	4361.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #176	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O	4298.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #177	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4361.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #178	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O	4398.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #179	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4347.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #18	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4347.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #180	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H]1O	4387.5	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #181	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O	4381.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #182	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C	4436.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #183	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4314.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #184	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4374.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #185	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C	4403.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #186	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4364.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #187	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4392.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #188	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C	4400.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #189	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4451.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #19	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4288.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #190	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4402.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #191	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H]1O	4424.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #192	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H]1O	4437.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #193	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4489.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #194	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H]1O	4423.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #195	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4478.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #196	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H]1O	4504.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #197	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4295.5	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #198	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C	4286.5	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #199	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4344.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #2	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4246.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #20	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4276.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #200	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4373.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #201	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O)O[Si](C)(C)C	4304.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #202	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4371.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #203	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O	4392.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #204	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4360.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #205	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O)O[Si](C)(C)C	4381.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #206	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O[Si](C)(C)C)[C@@H]1O	4399.7	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #207	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C	4451.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #208	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4313.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #209	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4365.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #21	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4338.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #210	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O	4395.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #211	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4375.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #212	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O	4407.5	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #213	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@@H]1O	4405.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #214	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C	4453.7	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #215	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4417.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #216	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O)O[Si](C)(C)C	4432.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #217	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O	4458.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #218	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4502.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #219	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O)O[Si](C)(C)C	4444.7	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #22	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4364.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #220	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4491.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #221	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O	4523.7	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #222	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O[Si](C)(C)C	4333.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #223	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4398.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #224	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O[Si](C)(C)C	4421.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #225	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4407.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #226	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O[Si](C)(C)C	4428.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #227	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@@H]1O[Si](C)(C)C	4437.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #228	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C	4488.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #229	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4434.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #23	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4312.5	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #230	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C)C3=O)[C@@H]1O	4451.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #231	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@@H]1O	4461.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #232	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C	4503.5	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #233	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[Si](C)(C)C)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@@H]1O	4469.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #234	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C	4510.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #235	C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@@H]1O	4538.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #236	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4428.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #237	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[Si](C)(C)C)O[C@H]1N1C=NC2=C1N=C(N)N([Si](C)(C)C)C2=O	4438.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #238	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H]1N1C=NC2=C1N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C2=O	4456.7	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #239	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C	4501.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #24	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4380.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #240	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[Si](C)(C)C)O[C@H]1N1C=NC2=C1N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C2=O	4465.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #241	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C	4509.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #242	C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H]1N1C=NC2=C1N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C2=O	4536.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #243	C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C3=O)[C@H](O)[C@@H]1O)OP(=O)(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)O[Si](C)(C)C	4506.7	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #244	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4545.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #245	C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O)OP(=O)(O)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O	4578.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #246	C[Si](C)(C)OP(=O)(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C3=O)[C@H](O)[C@@H]1O	4589.7	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #25	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O	4401.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #26	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4369.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #27	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4392.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #28	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O	4417.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #29	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N1[Si](C)(C)C	4465.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #3	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4272.5	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #30	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	4266.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #31	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	4258.5	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #32	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4298.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #33	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4285.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #34	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4338.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #35	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4370.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #36	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4257.5	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #37	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4275.5	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #38	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4262.5	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #39	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4314.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #4	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4308.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #40	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4361.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #41	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4295.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #42	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4284.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #43	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4341.5	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #44	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4378.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #45	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4323.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #46	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4384.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #47	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4415.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #48	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)[NH]1	4371.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #49	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4406.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #5	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4297.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #50	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4421.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #51	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N1[Si](C)(C)C	4467.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #52	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4303.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #53	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	4302.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #54	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	4291.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #55	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4347.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #56	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	4377.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #57	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	4303.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #58	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	4287.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #59	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4346.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #6	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4357.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #60	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	4373.5	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #61	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4321.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #62	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4383.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #63	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4413.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #64	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4370.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #65	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4401.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #66	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4418.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #67	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4469.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #68	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4298.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #69	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4282.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #7	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4387.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #70	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4342.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #71	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4369.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #72	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4299.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #73	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4363.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #74	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4401.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #75	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4347.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #76	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4389.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #77	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4390.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #78	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4451.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #79	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4324.7	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #8	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	4260.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #80	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4392.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #81	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4420.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #82	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4379.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #83	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4408.2	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #84	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4424.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #85	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4476.7	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #86	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4418.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #87	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4441.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #88	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O	4467.1	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #89	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)O[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4510.0	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #9	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	4253.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #90	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4456.6	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #91	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C	4501.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #92	C[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O	4547.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #93	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO	4245.4	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #94	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C	4242.8	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #95	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O	4290.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #96	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H]1O	4281.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #97	C[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)[NH]1	4341.9	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #98	C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O	4373.3	Semi standard non polar	33892256
GDP-glucose,4TMS,isomer #99	C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C	4263.0	Semi standard non polar	33892256
GDP-glucose,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O	4918.5	Semi standard non polar	33892256
GDP-glucose,1TBDMS,isomer #10	CC(C)(C)[Si](C)(C)N1C(N)=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C1=O	4934.5	Semi standard non polar	33892256
GDP-glucose,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@H]1O	4904.3	Semi standard non polar	33892256
GDP-glucose,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H]1O	4884.8	Semi standard non polar	33892256
GDP-glucose,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O	4900.9	Semi standard non polar	33892256
GDP-glucose,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4941.0	Semi standard non polar	33892256
GDP-glucose,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H]1N1C=NC2=C1N=C(N)[NH]C2=O	4936.1	Semi standard non polar	33892256
GDP-glucose,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O)OP(=O)(O)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O	4987.8	Semi standard non polar	33892256
GDP-glucose,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OP(=O)(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O	4997.5	Semi standard non polar	33892256
GDP-glucose,1TBDMS,isomer #9	CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4943.1	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O	4906.8	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](O)[C@H]1O	4863.2	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O	4861.3	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[C@@H]1CO	4821.6	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C	4806.1	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@H]1O	4918.4	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O	4913.0	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4890.2	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C(C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@H]1O	4917.4	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H]1O	4831.4	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O	4829.1	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4906.5	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C	4841.2	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H]1O	4897.6	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C(C)(C)C)[C@@H]1O	4884.4	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4865.2	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C(C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H]1O	4907.3	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O	4856.9	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4855.0	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O	4912.9	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O)O[Si](C)(C)C(C)(C)C	4906.9	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4889.5	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O	4889.5	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #30	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C(C)(C)C)C3=O)[C@H](O)[C@@H]1O	4914.1	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #31	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O[Si](C)(C)C(C)(C)C	4910.0	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #32	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4943.1	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #33	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[Si](C)(C)C(C)(C)C)O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@@H]1O	4947.6	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #34	CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)C(=O)[NH]1	4920.0	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #35	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C(C)(C)C)C3=O)[C@@H]1O	4953.0	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #36	CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H]1N1C=NC2=C1N=C(N)[NH]C2=O	4944.0	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #37	CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[Si](C)(C)C(C)(C)C)O[C@H]1N1C=NC2=C1N=C(N)[NH]C2=O	4946.7	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #38	CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)[NH]1	4926.4	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #39	CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H]1N1C=NC2=C1N=C(N)N([Si](C)(C)C(C)(C)C)C2=O	4955.7	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O	4853.7	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)[NH]C3=O)[C@H](O)[C@@H]1O)OP(=O)(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)O[Si](C)(C)C(C)(C)C	4990.6	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #41	CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4986.9	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C(C)(C)C)C3=O)[C@H](O)[C@@H]1O)OP(=O)(O)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O	4993.5	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #43	CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)C(=O)[NH]1	4994.5	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OP(=O)(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=NC3=C2N=C(N)N([Si](C)(C)C(C)(C)C)C3=O)[C@H](O)[C@@H]1O	5004.6	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #45	CC(C)(C)[Si](C)(C)N(C1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1)[Si](C)(C)C(C)(C)C	5016.8	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #46	CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)N1[Si](C)(C)C(C)(C)C	5040.9	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C	4884.7	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O	4951.9	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O	4944.2	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)C(=O)[NH]1	4915.0	Semi standard non polar	33892256
GDP-glucose,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C(C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O	4939.0	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (Non-derivatized) - 70eV, Positive	splash10-05bu-5842490000-d73f755e03b8ad234b29	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (1 TMS) - 70eV, Positive	splash10-01r6-4982808000-88b30cc719d45bf18e40	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_1_1) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_1_10) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - GDP-glucose GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-16	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - GDP-glucose 10V, Positive-QTOF	splash10-0udi-0910510000-079280e60cb5f2503d3a	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - GDP-glucose 20V, Positive-QTOF	splash10-0udi-0910000000-29db1fbcd1fe8812ecd3	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - GDP-glucose 40V, Positive-QTOF	splash10-0udi-1900000000-5bd106e57c79720052cc	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - GDP-glucose 10V, Negative-QTOF	splash10-0udi-1901445000-b4d8fa4ec316d0d695da	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - GDP-glucose 20V, Negative-QTOF	splash10-0udi-2901100000-be324e85f91ed7a7c416	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - GDP-glucose 40V, Negative-QTOF	splash10-0pdl-3900000000-771d4718d1ce0fb3b0a5	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - GDP-glucose 10V, Negative-QTOF	splash10-0udi-0000009000-3f663b5fce4f431e1e25	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - GDP-glucose 20V, Negative-QTOF	splash10-0udi-4701986000-bb5e3a66be23d7de55e6	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - GDP-glucose 40V, Negative-QTOF	splash10-05i0-3911810000-ee275d8a12bcf1e5065c	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - GDP-glucose 10V, Positive-QTOF	splash10-0udi-0900002000-37d2f661727ecc1c915a	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - GDP-glucose 20V, Positive-QTOF	splash10-0udi-0900001000-de8f3c7c7e6a620f0e90	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - GDP-glucose 40V, Positive-QTOF	splash10-0udr-2930000000-7a0fc600f843201b86c4	2021-09-24	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm (predicted from logP)

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB023150

KNApSAcK ID

Not Available

Chemspider ID

559146

KEGG Compound ID

C00394

BioCyc ID

GDP-D-GLUCOSE

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

6900

PubChem Compound

644106

PDB ID

Not Available

ChEBI ID

62254

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Carlson, Don M.; Hansen, R. G. The isolation and synthesis of guanosine diphosphate glucose. Journal of Biological Chemistry (1962), 237 1260-5.

Material Safety Data Sheet (MSDS)

Not Available

General References

Chandra GR, Mandava N, Warthen JD Jr: Uridine diphosphate glucose:fatty acid glucosyl transferase activity of rape (Brassica napus L.) anther tissue. Biochim Biophys Acta. 1978 Oct 12;526(2):387-97. [PubMed:718943 ]
Orlean PA: (1,3)-beta-D-Glucan synthase from budding and filamentous cultures of the dimorphic fungus Candida albicans. Eur J Biochem. 1982 Oct;127(2):397-403. [PubMed:6216107 ]

Enzymes

Enzyme Details

1. Uridine diphosphate glucose pyrophosphatase

General function:: Involved in hydrolase activity, acting on acid anhydrides, in phosphorus-containing anhydrides
Specific function:: Hydrolyzes UDP-glucose to glucose 1-phosphate and UMP and ADP-ribose to ribose 5-phosphate and AMP. The physiological substrate is probably UDP-glucose. Poor activity on other substrates such as ADP-glucose, CDP-glucose, GDP-glucose and GDP-mannose.
Gene Name:: NUDT14
Uniprot ID:: O95848
Molecular weight:: 24118.085

Enzyme Details

2. GDP-D-glucose phosphorylase 1

General function:: Not Available
Specific function:: Specific and highly efficient GDP-D-glucose phosphorylase regulating the levels of GDP-D-glucose in cells.
Gene Name:: GDPGP1
Uniprot ID:: Q6ZNW5
Molecular weight:: 42362.06

Reactions

GDP-glucose + Phosphate → Glucose 1-phosphate + Guanosine diphosphate	details

Showing metabocard for GDP-glucose (HMDB0003351)

MOL for HMDB0003351 (GDP-glucose)

3D MOL for HMDB0003351 (GDP-glucose)

3D SDF for HMDB0003351 (GDP-glucose)

3D-SDF for HMDB0003351 (GDP-glucose)

PDB for HMDB0003351 (GDP-glucose)

3D PDB for HMDB0003351 (GDP-glucose)

SMILES for HMDB0003351 (GDP-glucose)

INCHI for HMDB0003351 (GDP-glucose)

Structure for HMDB0003351 (GDP-glucose)

3D Structure for HMDB0003351 (GDP-glucose)

Experimental Collision Cross Sections

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra

Enzymes

Reactions