1-oleoyl-sn-glycerol (CHEBI:75757)

ChEBI > Main

CHEBI:75757 - 1-oleoyl-sn-glycerol

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	1-oleoyl-sn-glycerol

ChEBI ID	CHEBI:75757

ChEBI ASCII Name	1-oleoyl-sn-glycerol

Definition	A 1-acyl-sn-glycerol in which the acyl group is specified as oleoyl.

Stars	This entity has been manually annotated by the ChEBI Team.

Submitter	laimo

Supplier Information	ZINC000032840901

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__096383218867865__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__096383218867865__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:75757","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__096383218867865__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"096383218867865","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__096383218867865__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

OLB - Ideal conformer

Mrv1927 04292111593D

starting HoverWatcher_5

Time for openFile(OLB - Ideal conformer

Mrv1927 04292111593D

65 64 0 0 0 0 999 V2000

5.7880 -0.1560 -0.0040 C 0 0 0 0 0 0 0 0 0 0 0 0

4.3880 0.1830 -0.4450 C 0 0 1 0 0 0 0 0 0 0 0 0

3.4400 -0.9520 -0.0520 C 0 0 1 0 0 0 0 0 0 0 0 0

2.0180 -0.6080 -0.5000 C 0 0 1 0 0 0 0 0 0 0 0 0

1.0710 -1.7440 -0.1070 C 0 0 1 0 0 0 0 0 0 0 0 0

6.0070 -1.1990 0.5650 O 0 0 0 0 0 0 0 0 0 0 0 0

6.7940 0.6980 -0.2500 O 0 0 0 0 0 0 0 0 0 0 0 0

8.1180 0.3030 0.1980 C 0 0 1 0 0 0 0 0 0 0 0 0

9.1260 1.3940 -0.1680 C 0 0 1 0 0 0 0 0 0 0 0 0

8.8220 2.5870 0.5590 O 0 0 0 0 0 0 0 0 0 0 0 0

10.5380 0.9250 0.1910 C 0 0 1 0 0 0 0 0 0 0 0 0

11.4890 1.8930 -0.2560 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.3510 -1.3990 -0.5540 C 0 0 1 0 0 0 0 0 0 0 0 0

-1.2980 -2.5350 -0.1620 C 0 0 1 0 0 0 0 0 0 0 0 0

-2.7200 -2.1910 -0.6090 C 0 0 1 0 0 0 0 0 0 0 0 0

-3.6530 -3.3090 -0.2220 C 0 0 0 0 0 0 0 0 0 0 0 0

-4.7410 -3.0480 0.4590 C 0 0 0 0 0 0 0 0 0 0 0 0

-5.1500 -1.6190 0.7090 C 0 0 1 0 0 0 0 0 0 0 0 0

4.0680 1.1060 0.0380 H 0 0 0 0 0 0 0 0 0 0 0 0

4.3690 0.3140 -1.5270 H 0 0 0 0 0 0 0 0 0 0 0 0

3.7600 -1.8760 -0.5360 H 0 0 0 0 0 0 0 0 0 0 0 0

3.4590 -1.0840 1.0300 H 0 0 0 0 0 0 0 0 0 0 0 0

1.6990 0.3150 -0.0160 H 0 0 0 0 0 0 0 0 0 0 0 0

2.0000 -0.4770 -1.5820 H 0 0 0 0 0 0 0 0 0 0 0 0

1.3910 -2.6670 -0.5900 H 0 0 0 0 0 0 0 0 0 0 0 0

1.0900 -1.8750 0.9750 H 0 0 0 0 0 0 0 0 0 0 0 0

8.1100 0.1630 1.2780 H 0 0 0 0 0 0 0 0 0 0 0 0

8.4020 -0.6310 -0.2870 H 0 0 0 0 0 0 0 0 0 0 0 0

9.0710 1.5970 -1.2370 H 0 0 0 0 0 0 0 0 0 0 0 0

8.8520 2.4800 1.5200 H 0 0 0 0 0 0 0 0 0 0 0 0

10.6180 0.8080 1.2720 H 0 0 0 0 0 0 0 0 0 0 0 0

10.7370 -0.0310 -0.2940 H 0 0 0 0 0 0 0 0 0 0 0 0

12.4080 1.6610 -0.0610 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.6700 -0.4760 -0.0710 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.3700 -1.2680 -1.6360 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.9790 -3.4580 -0.6450 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.2790 -2.6660 0.9200 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.0400 -1.2680 -0.1250 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.7390 -2.0600 -1.6910 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.4240 -4.3260 -0.5060 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.3460 -3.8580 0.8410 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.0800 -1.4030 1.7750 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.4880 -0.9510 0.1580 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.5910 -1.4110 0.2400 C 0 0 2 0 0 0 0 0 0 0 0 0

-7.2530 -2.0800 0.7910 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.0050 0.0400 0.4940 C 0 0 1 0 0 0 0 0 0 0 0 0

-6.6610 -1.6280 -0.8260 H 0 0 0 0 0 0 0 0 0 0 0 0

-8.4470 0.2480 0.0250 C 0 0 1 0 0 0 0 0 0 0 0 0

-6.9350 0.2560 1.5600 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.3440 0.7080 -0.0570 H 0 0 0 0 0 0 0 0 0 0 0 0

-8.5170 0.0310 -1.0410 H 0 0 0 0 0 0 0 0 0 0 0 0

-9.1080 -0.4210 0.5760 H 0 0 0 0 0 0 0 0 0 0 0 0

-8.8610 1.6990 0.2780 C 0 0 1 0 0 0 0 0 0 0 0 0

-10.3020 1.9070 -0.1910 C 0 0 1 0 0 0 0 0 0 0 0 0

-8.7910 1.9150 1.3440 H 0 0 0 0 0 0 0 0 0 0 0 0

-8.1990 2.3670 -0.2720 H 0 0 0 0 0 0 0 0 0 0 0 0

-10.3720 1.6900 -1.2570 H 0 0 0 0 0 0 0 0 0 0 0 0

-10.9640 1.2380 0.3600 H 0 0 0 0 0 0 0 0 0 0 0 0

-10.7170 3.3580 0.0630 C 0 0 1 0 0 0 0 0 0 0 0 0

-12.1580 3.5660 -0.4060 C 0 0 0 0 0 0 0 0 0 0 0 0

-10.6470 3.5740 1.1290 H 0 0 0 0 0 0 0 0 0 0 0 0

-10.0550 4.0260 -0.4880 H 0 0 0 0 0 0 0 0 0 0 0 0

-12.8200 2.8980 0.1450 H 0 0 0 0 0 0 0 0 0 0 0 0

-12.4530 4.6000 -0.2250 H 0 0 0 0 0 0 0 0 0 0 0 0

-12.2280 3.3490 -1.4720 H 0 0 0 0 0 0 0 0 0 0 0 0

1 6 2 0 0 0 0

1 7 1 0 0 0 0

2 1 1 0 0 0 0

3 2 1 0 0 0 0

4 3 1 0 0 0 0

5 4 1 0 0 0 0

5 13 1 0 0 0 0

7 8 1 0 0 0 0

8 9 1 0 0 0 0

9 11 1 0 0 0 0

10 9 1 0 0 0 0

11 12 1 0 0 0 0

13 14 1 0 0 0 0

14 15 1 0 0 0 0

15 16 1 0 0 0 0

16 17 2 0 0 0 0

17 18 1 0 0 0 0

2 19 1 0 0 0 0

2 20 1 0 0 0 0

3 21 1 0 0 0 0

3 22 1 0 0 0 0

4 23 1 0 0 0 0

4 24 1 0 0 0 0

5 25 1 0 0 0 0

5 26 1 0 0 0 0

8 27 1 0 0 0 0

8 28 1 0 0 0 0

9 29 1 6 0 0 0

10 30 1 0 0 0 0

11 31 1 0 0 0 0

11 32 1 0 0 0 0

12 33 1 0 0 0 0

13 34 1 0 0 0 0

13 35 1 0 0 0 0

14 36 1 0 0 0 0

14 37 1 0 0 0 0

15 38 1 0 0 0 0

15 39 1 0 0 0 0

16 40 1 0 0 0 0

17 41 1 0 0 0 0

18 42 1 0 0 0 0

18 43 1 0 0 0 0

18 44 1 0 0 0 0

44 45 1 0 0 0 0

44 46 1 0 0 0 0

44 47 1 0 0 0 0

46 48 1 0 0 0 0

46 49 1 0 0 0 0

46 50 1 0 0 0 0

48 51 1 0 0 0 0

48 52 1 0 0 0 0

48 53 1 0 0 0 0

53 54 1 0 0 0 0

53 55 1 0 0 0 0

53 56 1 0 0 0 0

54 57 1 0 0 0 0

54 58 1 0 0 0 0

54 59 1 0 0 0 0

59 60 1 0 0 0 0

59 61 1 0 0 0 0

59 62 1 0 0 0 0

60 63 1 0 0 0 0

60 64 1 0 0 0 0

60 65 1 0 0 0 0

M END): 24 ms

reading 65 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

65 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Molfile

Formula

C21H40O4

Net Charge

Average Mass

356.547

Monoisotopic Mass

356.29266

InChI

InChI=1S/C21H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h9-10,20,22-23H,2-8,11-19H2,1H3/b10-9-/t20-/m0/s1

InChIKey

RZRNAYUHWVFMIP-QJRAZLAKSA-N

SMILES

CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](O)CO

Roles Classification
Biological Role(s):	plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. (via 1-oleoylglycerol ) human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). (via monoacylglycerol 18:1 )

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	1-oleoyl-sn-glycerol (CHEBI:75757) has functional parent oleic acid (CHEBI:16196) 1-oleoyl-sn-glycerol (CHEBI:75757) is a 1-acyl-sn-glycerol (CHEBI:64683) 1-oleoyl-sn-glycerol (CHEBI:75757) is a 1-oleoylglycerol (CHEBI:75342)

IUPAC Name

(2S)-2,3-dihydroxypropyl (9Z)-octadec-9-enoate

Synonyms	Sources
1-(9Z-octadecenoyl)-sn-glycerol	UniProt
1-monoolein	ChEBI
MAG(18:1)	HMDB
MAG(18:1/0:0)	HMDB
MAG(18:1ω9/0:0)	HMDB
MG(18:1(9Z)/0:0/0:0)	HMDB
MG(18:1(ω-9)/0:0/0:0)	SUBMITTER
MG(18:1)	HMDB
MG(18:1/0:0)	HMDB
MG(18:1ω9/0:0)	HMDB
sn-1-monooleoylglycerol	SUBMITTER

Manual Xrefs	Databases
23010051	ChemSpider
FDB028280	FooDB
HMDB0011567	HMDB
OLB	PDBeChem
View more database links

Registry Number	Type	Source
6482893	Reaxys Registry Number	Reaxys

Citations

Shimotoyodome A, Osaki N, Onizawa K, Mizuno T, Suzukamo C, Okahara F, Fukuoka D, Hase T (2012)
Dietary 1-monoolein decreases postprandial GIP release by reducing jejunal transport of glucose and fatty acid in rodents.
American journal of physiology. Gastrointestinal and liver physiology 303, G298-310 [PubMed:22651926]
[show Abstract]

Paris R, Clement G (1969)
Biosynthesis of lysophosphatidic acid from ATP and 1-monoolein by subcellular particles of intestinal mucosa.
Proceedings of the Society for Experimental Biology and Medicine. Society for Experimental Biology and Medicine (New York, N.Y.) 131, 363-365 [PubMed:5787111]

Last Modified

29 April 2021

CHEBI:75757 - 1-oleoyl-sn-glycerol

ChEBI is part of the ELIXIR infrastructure