3-(1H-indol-3-yl)propanoic acid (CHEBI:43580)

ChEBI > Main

CHEBI:43580 - 3-(1H-indol-3-yl)propanoic acid

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	3-(1H-indol-3-yl)propanoic acid

ChEBI ID	CHEBI:43580

ChEBI ASCII Name	3-(1H-indol-3-yl)propanoic acid

Definition	An indol-3-yl carboxylic acid that is propionic acid substituted by a 1H-indol-3-yl group at position 3.

Stars	This entity has been manually annotated by the ChEBI Team.

Supplier Information	ChemicalBook:CB5928169, ZINC000060094177

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__934050957124086__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__934050957124086__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:43580","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__934050957124086__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"934050957124086","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__934050957124086__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Mrv0541 03111411363D

starting HoverWatcher_5

Time for openFile(

Mrv0541 03111411363D

25 26 0 0 0 0 999 V2000

0.2830 -0.1450 3.5200 C 0 0 0 0 0 0 0 0 0 0 0 0

0.3100 1.0170 3.8460 O 0 0 0 0 0 0 0 0 0 0 0 0

0.5950 -1.0990 4.4110 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.1010 -0.5250 2.1130 C 0 0 1 0 0 0 0 0 0 0 0 0

-0.4060 0.7390 1.3090 C 0 0 1 0 0 0 0 0 0 0 0 0

-1.9900 -0.2100 -1.8760 N 0 0 0 0 0 0 0 0 0 0 0 0

-2.0300 0.0980 -0.5430 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.7910 0.3590 -0.0970 C 0 0 0 0 0 0 0 0 0 0 0 0

0.1150 0.2100 -1.2380 C 0 0 0 0 0 0 0 0 0 0 0 0

1.4950 0.3380 -1.4040 C 0 0 0 0 0 0 0 0 0 0 0 0

2.0540 0.1200 -2.6320 C 0 0 0 0 0 0 0 0 0 0 0 0

1.2610 -0.2340 -3.7150 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.1020 -0.3720 -3.5720 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.6920 -0.1540 -2.3310 C 0 0 0 0 0 0 0 0 0 0 0 0

0.8420 -0.8550 5.3140 H 0 0 0 0 0 0 0 0 0 0 0 0

0.7220 -1.0640 1.6450 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.9850 -1.1620 2.1380 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.2300 1.2780 1.7770 H 0 0 0 0 0 0 0 0 0 0 0 0

0.4770 1.3760 1.2840 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.7620 -0.4350 -2.4190 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.9250 0.1270 0.0590 H 0 0 0 0 0 0 0 0 0 0 0 0

2.1180 0.6130 -0.5660 H 0 0 0 0 0 0 0 0 0 0 0 0

3.1210 0.2240 -2.7610 H 0 0 0 0 0 0 0 0 0 0 0 0

1.7170 -0.4030 -4.6790 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.7100 -0.6490 -4.4200 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 2 0 0 0 0

1 3 1 0 0 0 0

1 4 1 0 0 0 0

3 15 1 0 0 0 0

4 5 1 0 0 0 0

4 16 1 0 0 0 0

4 17 1 0 0 0 0

5 8 1 0 0 0 0

5 18 1 0 0 0 0

5 19 1 0 0 0 0

6 7 4 0 0 0 0

6 14 4 0 0 0 0

6 20 1 0 0 0 0

7 8 4 0 0 0 0

7 21 1 0 0 0 0

8 9 4 0 0 0 0

9 10 4 0 0 0 0

9 14 4 0 0 0 0

10 11 4 0 0 0 0

10 22 1 0 0 0 0

11 12 4 0 0 0 0

11 23 1 0 0 0 0

12 13 4 0 0 0 0

12 24 1 0 0 0 0

13 14 4 0 0 0 0

13 25 1 0 0 0 0

M END): 77 ms

reading 25 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

25 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Formula

C11H11NO2

Net Charge

Average Mass

189.21050

Monoisotopic Mass

189.07898

InChI

InChI=1S/C11H11NO2/c13-11(14)6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5-6H2,(H,13,14)

InChIKey

GOLXRNDWAUTYKT-UHFFFAOYSA-N

SMILES

OC(=O)CCc1c[nH]c2ccccc12

Metabolite of Species	Details
Homo sapiens (NCBI:txid9606)	Found in blood serum (BTO:0000133). See: MetaboLights Study

Roles Classification
Chemical Role(s):	Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Bronsted base). (via oxoacid )

Biological Role(s):	auxin Any of a group of compounds, both naturally occurring and synthetic, that induce cell elongation in plant stems (from Greek alphaupsilonxialphanuomega, "to grow"). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	3-(1H-indol-3-yl)propanoic acid (CHEBI:43580) has functional parent propionic acid (CHEBI:30768) 3-(1H-indol-3-yl)propanoic acid (CHEBI:43580) has role auxin (CHEBI:22676) 3-(1H-indol-3-yl)propanoic acid (CHEBI:43580) has role human metabolite (CHEBI:77746) 3-(1H-indol-3-yl)propanoic acid (CHEBI:43580) has role plant metabolite (CHEBI:76924) 3-(1H-indol-3-yl)propanoic acid (CHEBI:43580) is a indol-3-yl carboxylic acid (CHEBI:24810) 3-(1H-indol-3-yl)propanoic acid (CHEBI:43580) is conjugate acid of 3-(1H-indol-3-yl)propanoate (CHEBI:82916)

Incoming	3-(1H-indol-3-yl)propanoate (CHEBI:82916) is conjugate base of 3-(1H-indol-3-yl)propanoic acid (CHEBI:43580)

IUPAC Name

3-(1H-indol-3-yl)propanoic acid

Synonyms	Sources
beta-(3-Indolyl)propionic acid	ChemIDplus
Indole-3-propionic acid	ChemIDplus
Indolepropionic acid	ChemIDplus

Manual Xrefs	Databases
HMDB0002302	HMDB
IOP	PDBeChem
View more database links

Registry Numbers	Types	Sources
147733	Reaxys Registry Number	Reaxys
830-96-6	CAS Registry Number	ChemIDplus
830-96-6	CAS Registry Number	NIST Chemistry WebBook

Citations	Types	Sources
12212784	PubMed citation	Europe PMC
14606996	PubMed citation	Europe PMC
21307383	PubMed citation	Europe PMC
22885049	PubMed citation	Europe PMC
24510403	PubMed citation	Europe PMC

Last Modified

23 October 2015

CHEBI:43580 - 3-(1H-indol-3-yl)propanoic acid

ChEBI is part of the ELIXIR infrastructure