glycochenodeoxycholic acid (CHEBI:36274)

ChEBI > Main

CHEBI:36274 - glycochenodeoxycholic acid

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	glycochenodeoxycholic acid

ChEBI ID	CHEBI:36274

Definition	A bile acid glycine conjugate having 3α,7α-dihydroxy-5β-cholan-24-oyl as the bile acid component.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:5463, CHEBI:41520, CHEBI:3591

Supplier Information	No supplier information found for this compound.

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__9930265230996693__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__9930265230996693__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:36274","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__9930265230996693__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"9930265230996693","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__9930265230996693__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 07130614533D

starting HoverWatcher_5

Time for openFile(

Marvin 07130614533D

75 78 0 0 1 0 999 V2000

-2.9435 -3.3626 3.0487 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.1200 -4.4694 1.9797 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.6323 -5.0687 2.3119 C 0 0 0 0 0 0 0 0 0 0 0 0

1.0163 -3.3545 3.3281 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.5096 -2.7071 3.1084 C 0 0 2 0 0 0 0 0 0 0 0 0

-2.1658 -0.8517 1.3265 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.7480 -0.0686 0.0591 C 0 0 0 0 0 0 0 0 0 0 0 0

2.0396 -0.0341 0.1310 C 0 0 0 0 0 0 0 0 0 0 0 0

1.7712 0.8690 -1.0946 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.5462 -1.7527 4.3590 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.1177 -1.9144 1.7922 C 0 0 1 0 0 0 0 0 0 0 0 0

-1.1444 -2.6328 0.9693 H 0 0 0 0 0 0 0 0 0 0 0 0

0.3692 -1.3844 1.7702 C 0 0 2 0 0 0 0 0 0 0 0 0

0.4956 -0.6678 2.5811 H 0 0 0 0 0 0 0 0 0 0 0 0

0.6448 -0.6126 0.4329 C 0 0 1 0 0 0 0 0 0 0 0 0

-0.3270 0.5908 0.1703 C 0 0 2 0 0 0 0 0 0 0 0 0

-0.2884 1.6774 1.3126 C 0 0 0 0 0 0 0 0 0 0 0 0

0.5086 -1.3715 -0.3524 H 0 0 0 0 0 0 0 0 0 0 0 0

0.4171 4.6914 -3.1575 C 0 0 0 0 0 0 0 0 0 0 0 0

0.5183 3.1564 -2.9204 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.6761 2.9251 -1.6624 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.1399 2.6570 -1.5925 C 0 0 1 0 0 0 0 0 0 0 0 0

0.2385 1.1816 -1.1791 C 0 0 1 0 0 0 0 0 0 0 0 0

-0.1451 0.5590 -1.9971 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.0823 -5.5999 2.1814 C 0 0 2 0 0 0 0 0 0 0 0 0

-2.1725 -6.5388 1.1096 O 0 0 0 0 0 0 0 0 0 0 0 0

1.4158 -2.4961 2.0966 C 0 0 2 0 0 0 0 0 0 0 0 0

1.6837 -3.3248 0.9661 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.4578 -3.8718 3.3091 C 0 0 1 0 0 0 0 0 0 0 0 0

-0.6295 -4.3115 4.2984 H 0 0 0 0 0 0 0 0 0 0 0 0

0.9794 5.1074 -4.4193 C 0 0 0 0 0 0 0 0 0 0 0 0

0.2892 5.0095 -5.4272 O 0 0 0 0 0 0 0 0 0 0 0 0

2.1993 5.5393 -4.4427 N 0 0 0 0 0 0 0 0 0 0 0 0

2.9354 6.0027 -5.5255 C 0 0 0 0 0 0 0 0 0 0 0 0

5.1567 5.3200 -5.4810 O 0 0 0 0 0 0 0 0 0 0 0 0

3.9988 5.0665 -5.7933 C 0 0 0 0 0 0 0 0 0 0 0 0

3.7616 3.9911 -6.3236 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.7252 -2.6138 2.9014 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.1860 -3.8238 4.0120 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.0345 -4.0443 0.9769 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.1285 -4.8856 2.0515 H 0 0 0 0 0 0 0 0 0 0 0 0

0.0107 -5.8980 2.6196 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.3060 -4.7901 1.3104 H 0 0 0 0 0 0 0 0 0 0 0 0

1.1721 -2.7525 4.2274 H 0 0 0 0 0 0 0 0 0 0 0 0

1.7130 -4.1911 3.4307 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.1189 -1.3295 1.0873 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.3777 -0.1361 2.1207 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.7819 -0.7592 -0.7906 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.5435 0.6445 -0.1336 H 0 0 0 0 0 0 0 0 0 0 0 0

2.4146 0.5449 0.9790 H 0 0 0 0 0 0 0 0 0 0 0 0

2.7781 -0.8116 -0.0852 H 0 0 0 0 0 0 0 0 0 0 0 0

2.3883 1.7653 -1.0030 H 0 0 0 0 0 0 0 0 0 0 0 0

2.0995 0.3487 -2.0017 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.6171 -1.2095 4.5225 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.3325 -0.9997 4.2831 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.7396 -2.3039 5.2818 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.5291 1.2977 2.3024 H 0 0 0 0 0 0 0 0 0 0 0 0

0.6902 2.1517 1.3976 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.0070 2.4771 1.1516 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.6132 5.0478 -3.1530 H 0 0 0 0 0 0 0 0 0 0 0 0

0.9007 5.2046 -2.3191 H 0 0 0 0 0 0 0 0 0 0 0 0

0.0850 2.6107 -3.7638 H 0 0 0 0 0 0 0 0 0 0 0 0

1.5843 2.9163 -2.9222 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.9166 3.9809 -1.7594 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.1352 2.3833 -2.4915 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.2040 2.6746 -0.7540 H 0 0 0 0 0 0 0 0 0 0 0 0

0.2641 3.3051 -0.8105 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.3361 -6.1445 3.0947 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.9262 -6.0404 0.3007 H 0 0 0 0 0 0 0 0 0 0 0 0

2.3750 -2.0198 2.3249 H 0 0 0 0 0 0 0 0 0 0 0 0

2.3739 -3.9561 1.2598 H 0 0 0 0 0 0 0 0 0 0 0 0

2.6493 5.5328 -3.6209 H 0 0 0 0 0 0 0 0 0 0 0 0

3.3234 6.9833 -5.2405 H 0 0 0 0 0 0 0 0 0 0 0 0

2.3439 6.1532 -6.4347 H 0 0 0 0 0 0 0 0 0 0 0 0

5.7996 4.7384 -5.6264 H 0 0 0 0 0 0 0 0 0 0 0 0

15 16 1 0 0 0 0

16 23 1 0 0 0 0

16 7 1 0 0 0 0

13 15 1 0 0 0 0

15 8 1 0 0 0 0

11 6 1 0 0 0 0

5 11 1 0 0 0 0

11 13 1 0 0 0 0

13 27 1 0 0 0 0

29 5 1 0 0 0 0

5 10 1 0 0 0 0

5 1 1 0 0 0 0

23 9 1 0 0 0 0

6 7 1 0 0 0 0

9 8 1 0 0 0 0

4 27 1 0 0 0 0

29 3 1 0 0 0 0

29 4 1 0 0 0 0

2 1 1 0 0 0 0

25 3 1 0 0 0 0

25 2 1 0 0 0 0

11 12 1 0 0 0 0

13 14 1 0 0 0 0

15 18 1 0 0 0 0

16 17 1 0 0 0 0

19 20 1 0 0 0 0

19 31 1 0 0 0 0

22 20 1 0 0 0 0

23 22 1 0 0 0 0

22 21 1 0 0 0 0

23 24 1 0 0 0 0

25 26 1 0 0 0 0

27 28 1 0 0 0 0

29 30 1 0 0 0 0

31 33 1 0 0 0 0

31 32 2 0 0 0 0

33 34 1 0 0 0 0

34 36 1 0 0 0 0

36 35 1 0 0 0 0

36 37 2 0 0 0 0

1 38 1 0 0 0 0

1 39 1 0 0 0 0

2 40 1 0 0 0 0

2 41 1 0 0 0 0

3 42 1 0 0 0 0

3 43 1 0 0 0 0

4 44 1 0 0 0 0

4 45 1 0 0 0 0

6 46 1 0 0 0 0

6 47 1 0 0 0 0

7 48 1 0 0 0 0

7 49 1 0 0 0 0

8 50 1 0 0 0 0

8 51 1 0 0 0 0

9 52 1 0 0 0 0

9 53 1 0 0 0 0

10 54 1 0 0 0 0

10 55 1 0 0 0 0

10 56 1 0 0 0 0

17 57 1 0 0 0 0

17 58 1 0 0 0 0

17 59 1 0 0 0 0

19 60 1 0 0 0 0

19 61 1 0 0 0 0

20 62 1 0 0 0 0

20 63 1 0 0 0 0

21 64 1 0 0 0 0

21 65 1 0 0 0 0

21 66 1 0 0 0 0

22 67 1 0 0 0 0

25 68 1 0 0 0 0

26 69 1 0 0 0 0

27 70 1 0 0 0 0

28 71 1 0 0 0 0

33 72 1 0 0 0 0

34 73 1 0 0 0 0

34 74 1 0 0 0 0

35 75 1 0 0 0 0

M END): 24 ms

reading 75 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

75 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
Flavin mononucleotide (FMN), or riboflavin-5′-phosphate, is a biomolecule produced from riboflavin (vitamin B2) by the enzyme riboflavin kinase and functions as the prosthetic group of various oxidoreductases, including NADH dehydrogenase, as well as a cofactor in biological blue-light photo receptors. During the catalytic cycle, various oxidoreductases induce reversible interconversions between the oxidized (FMN), semiquinone (FMNH•), and reduced (FMNH2) forms of the isoalloxazine core. FMN is a stronger oxidizing agent than NAD and is particularly useful because it can take part in both one- and two-electron transfers. In its role as blue-light photo receptor, (oxidized) FMN stands out from the 'conventional' photo receptors as the signaling state and not an E/Z isomerization. It is the principal form in which riboflavin is found in cells and tissues. It requires more energy to produce, but is more soluble than riboflavin. In cells, FMN occurs freely circulating but also in several covalently bound forms. Covalently or non-covalently bound FMN is a cofactor of many enzymes playing an important pathophysiological role in cellular metabolism. For example dissociation of flavin mononucleotide from mitochondrial complex I has been shown to occur during ischemia/reperfusion brain injury during stroke.
Read full article at Wikipedia

Formula

C26H43NO5

Net Charge

Average Mass

449.62336

Monoisotopic Mass

449.31412

InChI

InChI=1S/C26H43NO5/c1-15(4-7-22(30)27-14-23(31)32)18-5-6-19-24-20(9-11-26(18,19)3)25(2)10-8-17(28)12-16(25)13-21(24)29/h15-21,24,28-29H,4-14H2,1-3H3,(H,27,30)(H,31,32)/t15-,16+,17-,18-,19+,20+,21-,24+,25+,26-/m1/s1

InChIKey

GHCZAUBVMUEKKP-GYPHWSFCSA-N

SMILES

[H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@]3(C)[C@]([H])(CC[C@@]3([H])[C@]1([H])[C@H](O)C2)[C@H](C)CCC(=O)NCC(O)=O

Metabolite of Species	Details
Homo sapiens (NCBI:txid9606)	See: PubMed

Roles Classification
Biological Role(s):	human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens).

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	glycochenodeoxycholic acid (CHEBI:36274) has functional parent chenodeoxycholic acid (CHEBI:16755) glycochenodeoxycholic acid (CHEBI:36274) has role human metabolite (CHEBI:77746) glycochenodeoxycholic acid (CHEBI:36274) is a bile acid glycine conjugate (CHEBI:36255) glycochenodeoxycholic acid (CHEBI:36274) is conjugate acid of glycochenodeoxycholate (CHEBI:36252)

Incoming	glycocholic acid (CHEBI:17687) has functional parent glycochenodeoxycholic acid (CHEBI:36274) sulfoglycochenodeoxycholic acid (CHEBI:72733) has functional parent glycochenodeoxycholic acid (CHEBI:36274) glycochenodeoxycholate (CHEBI:36252) is conjugate base of glycochenodeoxycholic acid (CHEBI:36274)

IUPAC Names

[(3α,7α-dihydroxy-24-oxo-5β-cholan-24-yl)amino]acetic acid

N-(3α,7α-dihydroxy-5β-cholan-24-oyl)glycine

Synonyms	Sources
chenodeoxycholylglycine	ChemIDplus
Chenodeoxyglycocholate	KEGG COMPOUND
chenodeoxyglycocholic acid	ChEBI
GCDCA	ChEBI
glycine chenodeoxycholate	ChemIDplus
Glycochenodeoxycholate	KEGG COMPOUND
GLYCOCHENODEOXYCHOLIC ACID	PDBeChem
Glycochenodeoxycholic acid	KEGG COMPOUND

Manual Xrefs	Databases
C05466	KEGG COMPOUND
CHO	PDBeChem
DB02123	DrugBank
Glycochenodeoxycholic_acid	Wikipedia
GLYCOCHENODEOXYCHOLIC_ACID	MetaCyc
HMDB0006898	HMDB
View more database links

Registry Numbers	Types	Sources
3226177	Beilstein Registry Number	Beilstein
3226177	Reaxys Registry Number	Reaxys
640-79-9	CAS Registry Number	ChemIDplus

Citations	Types	Sources
22770225	PubMed citation	Europe PMC
23078175	PubMed citation	Europe PMC

Last Modified

21 January 2016

CHEBI:36274 - glycochenodeoxycholic acid

ChEBI is part of the ELIXIR infrastructure