thymidine (CHEBI:17748)

ChEBI > Main

CHEBI:17748 - thymidine

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	thymidine

ChEBI ID	CHEBI:17748

Definition	A pyrimidine 2'-deoxyribonucleoside having thymine as the nucleobase.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:19273, CHEBI:45834, CHEBI:45917, CHEBI:45918, CHEBI:45782, CHEBI:9579, CHEBI:15244

Supplier Information	ChemicalBook:CB6134417, eMolecules:532057, eMolecules:28206777, ZINC000000025672

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__059187101349879__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__059187101349879__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:17748","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__059187101349879__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"059187101349879","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__059187101349879__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 01220714303D

starting HoverWatcher_5

Time for openFile(

Marvin 01220714303D

31 32 0 0 1 0 999 V2000

-0.3193 -0.1023 -0.5297 C 0 0 2 0 0 0 0 0 0 0 0 0

0.9839 0.3504 -0.1742 N 0 0 0 0 0 0 0 0 0 0 0 0

-1.4124 0.8185 -0.3924 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.8355 -1.2693 0.3420 C 0 0 0 0 0 0 0 0 0 0 0 0

1.2426 1.5656 0.3279 C 0 0 0 0 0 0 0 0 0 0 0 0

2.0239 -0.4814 -0.3491 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.6550 0.1091 -0.4530 C 0 0 1 0 0 0 0 0 0 0 0 0

-2.3485 -1.3153 0.0701 C 0 0 1 0 0 0 0 0 0 0 0 0

2.4564 1.8931 0.6960 N 0 0 0 0 0 0 0 0 0 0 0 0

0.4285 2.4678 0.4731 O 0 0 0 0 0 0 0 0 0 0 0 0

3.3052 -0.1448 -0.0644 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.6759 -2.3142 -0.8949 O 0 0 0 0 0 0 0 0 0 0 0 0

3.4840 1.1279 0.4317 C 0 0 0 0 0 0 0 0 0 0 0 0

4.3886 -1.0985 -0.2745 C 0 0 0 0 0 0 0 0 0 0 0 0

4.5847 1.6201 0.6354 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.7289 0.8777 0.3478 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.9091 2.1947 -0.1600 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.2974 -0.3979 -1.5881 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.6544 -1.0449 1.3981 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.3458 -2.2176 0.1075 H 0 0 0 0 0 0 0 0 0 0 0 0

1.8649 -1.3992 -0.7071 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.9647 0.0758 -1.5031 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.8851 -1.5651 0.9900 H 0 0 0 0 0 0 0 0 0 0 0 0

2.5937 2.6965 1.1579 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.6485 -2.2531 -1.0029 H 0 0 0 0 0 0 0 0 0 0 0 0

4.2392 -1.9739 0.3615 H 0 0 0 0 0 0 0 0 0 0 0 0

4.4098 -1.4272 -1.3158 H 0 0 0 0 0 0 0 0 0 0 0 0

5.3773 -0.6988 -0.0432 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.6843 0.3524 0.2895 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.4359 0.9541 1.3971 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.5822 2.5997 0.4267 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 1 0 0 0 0

1 3 1 0 0 0 0

1 4 1 0 0 0 0

2 5 1 0 0 0 0

2 6 1 0 0 0 0

3 7 1 0 0 0 0

4 8 1 0 0 0 0

5 9 1 0 0 0 0

5 10 2 0 0 0 0

6 11 2 0 0 0 0

7 16 1 0 0 0 0

8 12 1 0 0 0 0

9 13 1 0 0 0 0

11 14 1 0 0 0 0

13 15 2 0 0 0 0

7 8 1 0 0 0 0

11 13 1 0 0 0 0

16 17 1 0 0 0 0

1 18 1 0 0 0 0

4 19 1 0 0 0 0

4 20 1 0 0 0 0

6 21 1 0 0 0 0

7 22 1 0 0 0 0

8 23 1 0 0 0 0

9 24 1 0 0 0 0

12 25 1 0 0 0 0

14 26 1 0 0 0 0

14 27 1 0 0 0 0

14 28 1 0 0 0 0

16 29 1 0 0 0 0

16 30 1 0 0 0 0

17 31 1 0 0 0 0

M END): 22 ms

reading 31 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

31 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
Thymidine (symbol dT or dThd), also known as deoxythymidine, deoxyribosylthymine, or thymine deoxyriboside, is a pyrimidine deoxynucleoside. Deoxythymidine is the DNA nucleoside T, which pairs with deoxyadenosine (A) in double-stranded DNA. In cell biology it is used to synchronize the cells in G1/early S phase. The prefix deoxy- is often left out since there are no precursors of thymine nucleotides involved in RNA synthesis. Before the boom in thymidine use caused by the need for thymidine in the production of the antiretroviral drug azidothymidine (AZT), much of the world's thymidine production came from herring sperm. Thymidine occurs almost exclusively in DNA but it also occurs in the T-loop of tRNA.
Read full article at Wikipedia

Formula

C10H14N2O5

Net Charge

Average Mass

242.22860

Monoisotopic Mass

242.09027

InChI

InChI=1S/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m0/s1

InChIKey

IQFYYKKMVGJFEH-XLPZGREQSA-N

SMILES

Cc1cn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]c1=O

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed
Escherichia coli (NCBI:txid562)	See: PubMed
Homo sapiens (NCBI:txid9606)	See: DOI

Roles Classification
Biological Role(s):	Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus).

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	thymidine (CHEBI:17748) has functional parent thymine (CHEBI:17821) thymidine (CHEBI:17748) has role Escherichia coli metabolite (CHEBI:76971) thymidine (CHEBI:17748) has role human metabolite (CHEBI:77746) thymidine (CHEBI:17748) has role metabolite (CHEBI:25212) thymidine (CHEBI:17748) has role mouse metabolite (CHEBI:75771) thymidine (CHEBI:17748) is a pyrimidine 2'-deoxyribonucleoside (CHEBI:19255) thymidine (CHEBI:17748) is enantiomer of telbivudine (CHEBI:63624)

Incoming	α-tritiated thymidine (CHEBI:53527) has functional parent thymidine (CHEBI:17748) 5'-O-{[3-(benzoyloxy)-3-oxopropyl]carbamoyl}thymidine (CHEBI:71524) has functional parent thymidine (CHEBI:17748) 5,6-dihydrothymidine (CHEBI:132171) has functional parent thymidine (CHEBI:17748) polyoxin (CHEBI:26194) has functional parent thymidine (CHEBI:17748) thymidine phosphate (CHEBI:27001) has functional parent thymidine (CHEBI:17748) tritiated thymidine (CHEBI:53526) has functional parent thymidine (CHEBI:17748) telbivudine (CHEBI:63624) is enantiomer of thymidine (CHEBI:17748)

IUPAC Name

thymidine

Synonyms	Sources
1-(2-deoxy-β-D-erythro-pentofuranosyl)-5-methylpyrimidine-2,4(1H,3H)-dione	ChEBI
2'-deoxy-5-methyluridine	ChemIDplus
2'-deoxythymidine	ChemIDplus
2'-thymidine	ChEBI
5-methyl-2'-deoxyuridine	ChemIDplus
Deoxythymidine	KEGG COMPOUND
dThd	CBN
T	ChEBI
Thymidine	KEGG COMPOUND
THYMIDINE	PDBeChem
thymidine	UniProt
thymine 2'-deoxyriboside	ChEBI

Manual Xrefs	Databases
C00019698	KNApSAcK
C00214	KEGG COMPOUND
DB04485	DrugBank
HMDB0000273	HMDB
THM	PDBeChem
Thymidine	Wikipedia
THYMIDINE	MetaCyc
View more database links

Registry Numbers	Types	Sources
282610	Gmelin Registry Number	Gmelin
50-89-5	CAS Registry Number	KEGG COMPOUND
50-89-5	CAS Registry Number	ChemIDplus
89285	Reaxys Registry Number	Reaxys

Citations

Roux A, Xu Y, Heilier JF, Olivier MF, Ezan E, Tabet JC, Junot C (2012)
Annotation of the human adult urinary metabolome and metabolite identification using ultra high performance liquid chromatography coupled to a linear quadrupole ion trap-Orbitrap mass spectrometer.
Analytical chemistry 84, 6429-6437 [PubMed:22770225]
[show Abstract]

Munns TW, Freeman SK (1989)
Antibody-nucleic acid complexes. Oligo(dG)n and -(dT)n specificities associated with anti-DNA antibodies from autoimmune MRL mice.
Biochemistry 28, 10048-10054 [PubMed:2559771]
[show Abstract]

Last Modified

23 January 2025

CHEBI:17748 - thymidine

ChEBI is part of the ELIXIR infrastructure