N-acetylserotonin (CHEBI:17697)

ChEBI > Main

CHEBI:17697 - N-acetylserotonin

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	N-acetylserotonin

ChEBI ID	CHEBI:17697

ChEBI ASCII Name	N-acetylserotonin

Definition	An N-acylserotonin resulting from the formal condensation of the primary amino group of serotonin with the carboxy group of acetic acid.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:40804, CHEBI:12582, CHEBI:21630, CHEBI:7223

Supplier Information	ChemicalBook:CB0174846, eMolecules:480363, ZINC000000087959

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__984061168614396__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__984061168614396__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:17697","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__984061168614396__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"984061168614396","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__984061168614396__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 09130717243D

starting HoverWatcher_5

Time for openFile(

Marvin 09130717243D

30 31 0 0 0 0 999 V2000

-1.6000 -0.0310 -2.8930 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.0840 -0.4010 -1.6670 C 0 0 0 0 0 0 0 0 0 0 0 0

0.2830 -0.2630 -1.4240 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.7630 0.4800 -3.8800 C 0 0 0 0 0 0 0 0 0 0 0 0

0.5860 0.6270 -3.6490 C 0 0 0 0 0 0 0 0 0 0 0 0

1.1250 0.2610 -2.4210 C 0 0 0 0 0 0 0 0 0 0 0 0

1.1440 -0.5390 -0.2710 C 0 0 0 0 0 0 0 0 0 0 0 0

2.3930 -0.1940 -0.6210 C 0 0 0 0 0 0 0 0 0 0 0 0

2.4020 0.2860 -1.9020 N 0 0 0 0 0 0 0 0 0 0 0 0

-2.9310 -0.1690 -3.1370 O 0 0 0 0 0 0 0 0 0 0 0 0

0.7100 -1.1100 1.0540 C 0 0 0 0 0 0 0 0 0 0 0 0

0.3340 0.0300 2.0010 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.0870 -0.5230 3.2900 N 0 0 0 0 0 0 0 0 0 0 0 0

-0.4670 0.3000 4.2870 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.9000 -0.2690 5.6120 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.4600 1.5010 4.1160 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.7340 -0.7990 -0.9010 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.1770 0.7670 -4.8360 H 0 0 0 0 0 0 0 0 0 0 0 0

1.2260 1.0260 -4.4220 H 0 0 0 0 0 0 0 0 0 0 0 0

3.2620 -0.2810 0.0140 H 0 0 0 0 0 0 0 0 0 0 0 0

3.1900 0.5980 -2.3740 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.0570 -1.0530 -3.5070 H 0 0 0 0 0 0 0 0 0 0 0 0

1.5280 -1.6860 1.4870 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.1520 -1.7590 0.9060 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.4830 0.6060 1.5690 H 0 0 0 0 0 0 0 0 0 0 0 0

1.1970 0.6790 2.1500 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.0920 -1.4840 3.4270 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.1690 0.5420 6.2870 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.7630 -0.9190 5.4640 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.0830 -0.8460 6.0450 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 4 0 0 0 0

1 4 4 0 0 0 0

1 10 1 0 0 0 0

2 3 4 0 0 0 0

2 17 1 0 0 0 0

3 6 4 0 0 0 0

3 7 4 0 0 0 0

4 5 4 0 0 0 0

4 18 1 0 0 0 0

5 6 4 0 0 0 0

5 19 1 0 0 0 0

6 9 4 0 0 0 0

7 8 4 0 0 0 0

7 11 1 0 0 0 0

8 9 4 0 0 0 0

8 20 1 0 0 0 0

9 21 1 0 0 0 0

10 22 1 0 0 0 0

11 12 1 0 0 0 0

11 23 1 0 0 0 0

11 24 1 0 0 0 0

12 13 1 0 0 0 0

12 25 1 0 0 0 0

12 26 1 0 0 0 0

13 14 1 0 0 0 0

13 27 1 0 0 0 0

14 15 1 0 0 0 0

14 16 2 0 0 0 0

15 28 1 0 0 0 0

15 29 1 0 0 0 0

15 30 1 0 0 0 0

M END): 21 ms

reading 30 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

30 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
Indole-3-carbaldehyde (I3A), also known as indole-3-aldehyde and 3-formylindole, is a metabolite of dietary L-tryptophan which is synthesized by human gastrointestinal bacteria, particularly species of the Lactobacillus genus. I3A is a biologically active metabolite which acts as a receptor agonist at the aryl hydrocarbon receptor in intestinal immune cells, in turn stimulating the production of interleukin-22 which facilitates mucosal reactivity.
Read full article at Wikipedia

Formula

C12H14N2O2

Net Charge

Average Mass

218.252

Monoisotopic Mass

218.10553

InChI

InChI=1S/C12H14N2O2/c1-8(15)13-5-4-9-7-14-12-3-2-10(16)6-11(9)12/h2-3,6-7,14,16H,4-5H2,1H3,(H,13,15)

InChIKey

MVAWJSIDNICKHF-UHFFFAOYSA-N

SMILES

C1=CC(=CC=2C(=CNC12)CCNC(C)=O)O

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed
Homo sapiens (NCBI:txid9606)	See: DOI

Roles Classification
Chemical Role(s):	antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides.

Biological Role(s):	human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). tropomyosin-related kinase B receptor agonist An agonist that binds to and deactivates the tropomyosin-related kinase B (TrkB) receptor, the main signaling receptor of the neurotrophin brain-derived neurotrophic factor (BDNF).

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	N-acetylserotonin (CHEBI:17697) has role antioxidant (CHEBI:22586) N-acetylserotonin (CHEBI:17697) has role human metabolite (CHEBI:77746) N-acetylserotonin (CHEBI:17697) has role mouse metabolite (CHEBI:75771) N-acetylserotonin (CHEBI:17697) has role tropomyosin-related kinase B receptor agonist (CHEBI:140489) N-acetylserotonin (CHEBI:17697) is a N-acylserotonin (CHEBI:134175) N-acetylserotonin (CHEBI:17697) is a acetamides (CHEBI:22160) N-acetylserotonin (CHEBI:17697) is a phenols (CHEBI:33853)

IUPAC Name

N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]acetamide

Synonyms	Sources
N-(2-(5-Hydroxy-1H-indol-3-yl)ethyl)acetamide	ChemIDplus
N-Acetyl-5-hydroxytryptamine	KEGG COMPOUND
N-Acetylserotonin	KEGG COMPOUND
N-acetylserotonin	UniProt

Manual Xrefs	Databases
ASE	PDBeChem
C00978	KEGG COMPOUND
DB04275	DrugBank
HMDB0001238	HMDB
LSM-20977	LINCS
N-acetyl-serotonin	Wikipedia
N-ACETYL-SEROTONIN	MetaCyc
View more database links

Registry Numbers	Types	Sources
1210-83-9	CAS Registry Number	KEGG COMPOUND
1210-83-9	CAS Registry Number	ChemIDplus
479159	Reaxys Registry Number	Reaxys

Citations

Last Modified

27 March 2018

CHEBI:17697 - N-acetylserotonin

ChEBI is part of the ELIXIR infrastructure