UDP-alpha-D-glucuronic acid (CHEBI:17200)

ChEBI > Main

CHEBI:17200 - UDP-α-D-glucuronic acid

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	UDP-α-D-glucuronic acid

ChEBI ID	CHEBI:17200

ChEBI ASCII Name	UDP-alpha-D-glucuronic acid

Definition	A UDP-sugar having α-D-glucuronic acid as the sugar component.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:46309, CHEBI:13506, CHEBI:13489, CHEBI:9846, CHEBI:22104

Supplier Information	ChemicalBook:CB7399440, eMolecules:484241, ZINC000000084153

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__776130821325886__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__776130821325886__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:17200","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__776130821325886__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"776130821325886","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__776130821325886__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 11300715423D

starting HoverWatcher_5

Time for openFile(

Marvin 11300715423D

59 61 0 0 1 0 999 V2000

-2.6296 -2.5465 0.6769 C 0 0 2 0 0 0 0 0 0 0 0 0

-1.9814 -3.2631 1.9039 C 0 0 1 0 0 0 0 0 0 0 0 0

-1.8829 -4.7996 1.7102 C 0 0 2 0 0 0 0 0 0 0 0 0

-3.2345 -5.3972 1.2448 C 0 0 1 0 0 0 0 0 0 0 0 0

-3.8106 -3.2376 0.2137 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.7461 -4.6595 -0.0259 C 0 0 2 0 0 0 0 0 0 0 0 0

3.4436 4.0796 -0.6404 C 0 0 2 0 0 0 0 0 0 0 0 0

4.1286 2.9487 -1.4257 C 0 0 2 0 0 0 0 0 0 0 0 0

4.6896 3.4034 -2.6574 O 0 0 0 0 0 0 0 0 0 0 0 0

2.9636 1.9596 -1.6761 C 0 0 2 0 0 0 0 0 0 0 0 0

2.0017 4.0798 -1.2043 C 0 0 1 0 0 0 0 0 0 0 0 0

1.7699 2.6584 -1.2918 O 0 0 0 0 0 0 0 0 0 0 0 0

4.1680 5.3033 -0.7421 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.0200 4.2652 0.1093 C 0 0 0 0 0 0 0 0 0 0 0 0

1.0535 4.8389 -0.4570 N 0 0 0 0 0 0 0 0 0 0 0 0

1.1931 6.1677 -0.3009 C 0 0 0 0 0 0 0 0 0 0 0 0

1.9603 6.8783 -0.9354 O 0 0 0 0 0 0 0 0 0 0 0 0

0.4381 6.8242 0.5480 N 0 0 0 0 0 0 0 0 0 0 0 0

-0.9006 4.9607 0.8611 C 0 0 0 0 0 0 0 0 0 0 0 0

-0.6427 6.2867 1.0522 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.4141 7.0022 1.6743 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.6948 -2.7331 2.2220 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.4932 -5.4344 2.9280 O 0 0 0 0 0 0 0 0 0 0 0 0

-5.0661 -5.1169 -0.4221 C 0 0 0 0 0 0 0 0 0 0 0 0

-6.0316 -4.9772 0.3227 O 0 0 0 0 0 0 0 0 0 0 0 0

-5.2578 -5.6712 -1.4949 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.1121 -6.8023 1.0240 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.8075 -2.3037 -0.3619 O 0 0 0 0 0 0 0 0 0 0 0 0

0.5106 -1.9954 -0.7169 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.0437 -0.5636 -1.7466 O 0 0 0 0 0 0 0 0 0 0 0 0

2.1265 -1.5257 0.9255 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.7580 -1.2995 -0.5416 P 0 0 1 0 0 0 0 0 0 0 0 0

-0.7286 -0.3393 0.5447 O 0 0 0 0 0 0 0 0 0 0 0 0

1.8691 -1.5224 -0.4937 P 0 0 1 0 0 0 0 0 0 0 0 0

2.7927 -2.4684 -1.0695 O 0 0 0 0 0 0 0 0 0 0 0 0

2.0949 -0.2007 -1.0745 O 0 0 0 0 0 0 0 0 0 0 0 0

3.1229 0.6346 -0.8896 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.0444 -1.5944 1.0248 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.6140 -3.0705 2.7751 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.1152 -5.0224 0.9634 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.9586 -5.2697 2.0564 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.0395 -4.8400 -0.8443 H 0 0 0 0 0 0 0 0 0 0 0 0

3.4078 3.8224 0.4234 H 0 0 0 0 0 0 0 0 0 0 0 0

4.9507 2.5314 -0.8372 H 0 0 0 0 0 0 0 0 0 0 0 0

5.0802 2.6029 -3.0674 H 0 0 0 0 0 0 0 0 0 0 0 0

2.8724 1.7228 -2.7411 H 0 0 0 0 0 0 0 0 0 0 0 0

2.0003 4.4650 -2.2323 H 0 0 0 0 0 0 0 0 0 0 0 0

4.1687 5.5309 -1.6957 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.2186 3.2979 -0.0058 H 0 0 0 0 0 0 0 0 0 0 0 0

0.6728 7.6971 0.7925 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.7015 4.5248 1.2579 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.3665 -3.2451 2.9895 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.6187 -5.0566 3.1563 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.8283 -5.2789 0.0993 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.4530 -6.8980 0.3055 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.4521 0.1077 0.7700 H 0 0 0 0 0 0 0 0 0 0 0 0

2.9169 -2.4976 -1.9401 H 0 0 0 0 0 0 0 0 0 0 0 0

4.0522 0.1560 -1.2162 H 0 0 0 0 0 0 0 0 0 0 0 0

3.2176 0.8800 0.1732 H 0 0 0 0 0 0 0 0 0 0 0 0

1 28 1 0 0 0 0

1 2 1 0 0 0 0

2 22 1 0 0 0 0

2 3 1 0 0 0 0

3 23 1 0 0 0 0

3 4 1 0 0 0 0

4 27 1 0 0 0 0

1 5 1 0 0 0 0

6 4 1 0 0 0 0

5 6 1 0 0 0 0

6 24 1 0 0 0 0

7 8 1 0 0 0 0

7 11 1 0 0 0 0

7 13 1 0 0 0 0

8 9 1 0 0 0 0

8 10 1 0 0 0 0

10 37 1 0 0 0 0

12 10 1 0 0 0 0

11 12 1 0 0 0 0

11 15 1 0 0 0 0

14 19 2 0 0 0 0

14 15 1 0 0 0 0

15 16 1 0 0 0 0

16 17 2 0 0 0 0

16 18 1 0 0 0 0

20 18 1 0 0 0 0

19 20 1 0 0 0 0

20 21 2 0 0 0 0

25 24 1 0 0 0 0

26 24 2 0 0 0 0

28 32 1 0 0 0 0

32 29 1 0 0 0 0

29 34 1 0 0 0 0

30 32 2 0 0 0 0

31 34 2 0 0 0 0

32 33 1 0 0 0 0

36 34 1 0 0 0 0

34 35 1 0 0 0 0

36 37 1 0 0 0 0

1 38 1 0 0 0 0

2 39 1 0 0 0 0

3 40 1 0 0 0 0

4 41 1 0 0 0 0

6 42 1 0 0 0 0

7 43 1 0 0 0 0

8 44 1 0 0 0 0

9 45 1 0 0 0 0

10 46 1 0 0 0 0

11 47 1 0 0 0 0

13 48 1 0 0 0 0

14 49 1 0 0 0 0

18 50 1 0 0 0 0

19 51 1 0 0 0 0

22 52 1 0 0 0 0

23 53 1 0 0 0 0

25 54 1 0 0 0 0

27 55 1 0 0 0 0

33 56 1 0 0 0 0

35 57 1 0 0 0 0

37 58 1 0 0 0 0

37 59 1 0 0 0 0

M END): 18 ms

reading 59 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

59 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License

Read full article at Wikipedia

Formula

C15H22N2O18P2

Net Charge

Average Mass

580.28538

Monoisotopic Mass

580.03429

InChI

InChI=1S/C15H22N2O18P2/c18-5-1-2-17(15(26)16-5)12-9(22)6(19)4(32-12)3-31-36(27,28)35-37(29,30)34-14-10(23)7(20)8(21)11(33-14)13(24)25/h1-2,4,6-12,14,19-23H,3H2,(H,24,25)(H,27,28)(H,29,30)(H,16,18,26)/t4-,6-,7+,8+,9-,10-,11+,12-,14-/m1/s1

InChIKey

HDYANYHVCAPMJV-LXQIFKJMSA-N

SMILES

O[C@@H]1[C@@H](COP(O)(=O)OP(O)(=O)O[C@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)C(O)=O)O[C@H]([C@@H]1O)n1ccc(=O)[nH]c1=O

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed
Escherichia coli (NCBI:txid562)	See: PubMed
Homo sapiens (NCBI:txid9606)	See: PubMed
Homo sapiens (NCBI:txid9606)	See: MetaboLights Study
Homo sapiens (NCBI:txid9606)	See: MetaboLights Study
Homo sapiens (NCBI:txid9606)	See: MetaboLights Study
Homo sapiens (NCBI:txid9606)	See: MetaboLights Study
Homo sapiens (NCBI:txid9606)	See: MetaboLights Study
Homo sapiens (NCBI:txid9606)	See: MetaboLights Study
Homo sapiens (NCBI:txid9606)	See: MetaboLights Study

Roles Classification
Biological Role(s):	Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus).

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	UDP-α-D-glucuronic acid (CHEBI:17200) has functional parent α-D-glucuronic acid (CHEBI:42717) UDP-α-D-glucuronic acid (CHEBI:17200) has role Escherichia coli metabolite (CHEBI:76971) UDP-α-D-glucuronic acid (CHEBI:17200) has role human metabolite (CHEBI:77746) UDP-α-D-glucuronic acid (CHEBI:17200) has role mouse metabolite (CHEBI:75771) UDP-α-D-glucuronic acid (CHEBI:17200) is a UDP-D-glucuronic acid (CHEBI:197331) UDP-α-D-glucuronic acid (CHEBI:17200) is conjugate acid of UDP-α-D-glucuronate(3−) (CHEBI:58052)

Incoming	UDP-2,3-diacetamido-2,3-dideoxy-α-D-glucuronic acid (CHEBI:48402) has functional parent UDP-α-D-glucuronic acid (CHEBI:17200) UDP-α-D-glucuronate(3−) (CHEBI:58052) is conjugate base of UDP-α-D-glucuronic acid (CHEBI:17200)

IUPAC Name

uridine 5'-[3-(α-D-glucopyranuronosyl) dihydrogen diphosphate]

Synonyms	Sources
UDP-alpha-D-glucuronate	KEGG COMPOUND
UDP-D-glucuronate	KEGG COMPOUND
UDPglucuronate	KEGG COMPOUND
UDPglucuronate	KEGG COMPOUND
uridine diphosphate glucuronic acid	ChemIDplus
URIDINE-5'-DIPHOSPHATE-GLUCURONIC ACID	PDBeChem

Manual Xrefs	Databases
C00007238	KNApSAcK
C00167	KEGG COMPOUND
G10612	KEGG GLYCAN
HMDB0000935	HMDB
UGA	PDBeChem
Uridine_diphosphate_glucuronic_acid	Wikipedia
View more database links

Registry Numbers	Types	Sources
2616-64-0	CAS Registry Number	ChemIDplus
78881	Reaxys Registry Number	Reaxys

Citations	Types	Sources
11420884	PubMed citation	Europe PMC
13984680	PubMed citation	Europe PMC
14351193	PubMed citation	Europe PMC
16300963	PubMed citation	Europe PMC
19375693	PubMed citation	Europe PMC
19564155	PubMed citation	Europe PMC

Last Modified

25 September 2023

CHEBI:17200 - UDP-α-D-glucuronic acid

ChEBI is part of the ELIXIR infrastructure