5-O-phosphono-alpha-D-ribofuranosyl diphosphate (CHEBI:17111)

ChEBI > Main

CHEBI:17111 - 5-O-phosphono-α-D-ribofuranosyl diphosphate

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	5-O-phosphono-α-D-ribofuranosyl diphosphate

ChEBI ID	CHEBI:17111

ChEBI ASCII Name	5-O-phosphono-alpha-D-ribofuranosyl diphosphate

Definition	A derivative of α-D-ribose having a phosphate group at the 5-position and a diphosphate at the 1-position.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:12160, CHEBI:12159, CHEBI:2121, CHEBI:45139, CHEBI:20625

Supplier Information	ChemicalBook:CB9666441, ChemicalBook:CB2112323, eMolecules:524832, ZINC000003802189

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__6832895936745764__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__6832895936745764__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:17111","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__6832895936745764__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"6832895936745764","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__6832895936745764__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 03310815213D

starting HoverWatcher_5

Time for openFile(

Marvin 03310815213D

35 35 0 0 0 0 999 V2000

1.0290 -0.9219 0.4644 C 0 0 1 0 0 0 0 0 0 0 0 0

0.4801 -2.3643 0.4119 C 0 0 1 0 0 0 0 0 0 0 0 0

-0.8762 -2.2232 -0.3129 C 0 0 1 0 0 0 0 0 0 0 0 0

-0.9903 -0.7117 -0.6116 C 0 0 1 0 0 0 0 0 0 0 0 0

-2.4350 -0.2362 -0.4495 C 0 0 0 0 0 0 0 0 0 0 0 0

1.9082 -0.6835 -0.6357 O 0 0 0 0 0 0 0 0 0 0 0 0

1.3592 -3.2108 -0.3308 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.8752 -2.9755 -1.5273 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.1381 -0.0783 0.3703 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.4982 1.1744 -0.6609 O 0 0 0 0 0 0 0 0 0 0 0 0

-4.0388 1.6043 -0.4763 P 0 0 1 0 0 0 0 0 0 0 0 0

-4.4878 1.2562 0.8899 O 0 0 0 0 0 0 0 0 0 0 0 0

-4.1851 3.1914 -0.7011 O 0 0 0 0 0 0 0 0 0 0 0 0

-4.9462 0.8242 -1.5530 O 0 0 0 0 0 0 0 0 0 0 0 0

2.9926 0.3985 -0.1403 P 0 0 1 0 0 0 0 0 0 0 0 0

2.2997 1.6436 0.2583 O 0 0 0 0 0 0 0 0 0 0 0 0

3.8020 -0.1919 1.1199 O 0 0 0 0 0 0 0 0 0 0 0 0

4.0213 0.7142 -1.3367 O 0 0 0 0 0 0 0 0 0 0 0 0

5.0713 1.7980 -0.7745 P 0 0 1 0 0 0 0 0 0 0 0 0

5.7826 1.2335 0.3931 O 0 0 0 0 0 0 0 0 0 0 0 0

6.1345 2.1627 -1.9259 O 0 0 0 0 0 0 0 0 0 0 0 0

4.2828 3.1296 -0.3313 O 0 0 0 0 0 0 0 0 0 0 0 0

1.5473 -0.7476 1.4076 H 0 0 0 0 0 0 0 0 0 0 0 0

0.3360 -2.7553 1.4194 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.6912 -2.5461 0.3343 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.6309 -0.4975 -1.6187 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.0673 -0.7411 -1.1799 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.7834 -0.4692 0.5549 H 0 0 0 0 0 0 0 0 0 0 0 0

2.1860 -3.2627 0.1668 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.7727 -3.9040 -1.2808 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.1197 3.4059 -0.5819 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.6224 1.0777 -2.4277 H 0 0 0 0 0 0 0 0 0 0 0 0

4.2379 -1.0010 0.8186 H 0 0 0 0 0 0 0 0 0 0 0 0

6.7438 2.8122 -1.5491 H 0 0 0 0 0 0 0 0 0 0 0 0

3.8331 3.4641 -1.1187 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 1 0 0 0 0

1 6 1 0 0 0 0

1 9 1 0 0 0 0

1 23 1 0 0 0 0

2 3 1 0 0 0 0

2 7 1 0 0 0 0

2 24 1 0 0 0 0

3 4 1 0 0 0 0

3 8 1 0 0 0 0

3 25 1 0 0 0 0

4 5 1 0 0 0 0

4 9 1 0 0 0 0

4 26 1 0 0 0 0

5 10 1 0 0 0 0

5 27 1 0 0 0 0

5 28 1 0 0 0 0

6 15 1 0 0 0 0

7 29 1 0 0 0 0

8 30 1 0 0 0 0

10 11 1 0 0 0 0

11 12 2 0 0 0 0

11 13 1 0 0 0 0

11 14 1 0 0 0 0

13 31 1 0 0 0 0

14 32 1 0 0 0 0

15 16 2 0 0 0 0

15 17 1 0 0 0 0

15 18 1 0 0 0 0

17 33 1 0 0 0 0

18 19 1 0 0 0 0

19 20 2 0 0 0 0

19 21 1 0 0 0 0

19 22 1 0 0 0 0

21 34 1 0 0 0 0

22 35 1 0 0 0 0

M END): 20 ms

reading 35 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

35 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Formula

C5H13O14P3

Net Charge

Average Mass

390.06960

Monoisotopic Mass

389.95182

InChI

InChI=1S/C5H13O14P3/c6-3-2(1-16-20(8,9)10)17-5(4(3)7)18-22(14,15)19-21(11,12)13/h2-7H,1H2,(H,14,15)(H2,8,9,10)(H2,11,12,13)/t2-,3-,4-,5-/m1/s1

InChIKey

PQGCEDQWHSBAJP-TXICZTDVSA-N

SMILES

O[C@H]1[C@@H](O)[C@H](O[C@@H]1COP(O)(O)=O)OP(O)(=O)OP(O)(O)=O

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed
Arabidopsis thaliana (NCBI:txid3702)	See: PubMed
Escherichia coli (NCBI:txid562)	See: PubMed
Homo sapiens (NCBI:txid9606)	See: PubMed

Roles Classification
Biological Role(s):	Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus).

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	5-O-phosphono-α-D-ribofuranosyl diphosphate (CHEBI:17111) has functional parent α-D-ribose (CHEBI:45506) 5-O-phosphono-α-D-ribofuranosyl diphosphate (CHEBI:17111) has role Escherichia coli metabolite (CHEBI:76971) 5-O-phosphono-α-D-ribofuranosyl diphosphate (CHEBI:17111) has role human metabolite (CHEBI:77746) 5-O-phosphono-α-D-ribofuranosyl diphosphate (CHEBI:17111) has role mouse metabolite (CHEBI:75771) 5-O-phosphono-α-D-ribofuranosyl diphosphate (CHEBI:17111) has role plant metabolite (CHEBI:76924) 5-O-phosphono-α-D-ribofuranosyl diphosphate (CHEBI:17111) is a 5-O-phosphono-D-ribofuranosyl diphosphate (CHEBI:48956) 5-O-phosphono-α-D-ribofuranosyl diphosphate (CHEBI:17111) is conjugate acid of 5-O-phosphonato-α-D-ribofuranosyl diphosphate(5−) (CHEBI:58017)

Incoming	5-O-phosphonato-α-D-ribofuranosyl diphosphate(5−) (CHEBI:58017) is conjugate base of 5-O-phosphono-α-D-ribofuranosyl diphosphate (CHEBI:17111)

IUPAC Name

5-O-phosphono-α-D-ribofuranose 1-(trihydrogen diphosphate)

Synonyms	Sources
5-Phospho-alpha-D-ribose 1-diphosphate	KEGG COMPOUND
5-Phosphoribosyl 1-pyrophosphate	KEGG COMPOUND
5-Phosphoribosyl diphosphate	KEGG COMPOUND
α-D-ribofuranose 5-(dihydrogen phosphate) 1-(trihydrogen diphosphate)	ChemIDplus
ALPHA-PHOSPHORIBOSYLPYROPHOSPHORIC ACID	PDBeChem
phosphoribosyl pyrophosphate	ChemIDplus
phosphoribosylpyrophosphate	ChEBI
PRib-PP	CBN
PRPP	KEGG COMPOUND

Manual Xrefs	Databases
C00007296	KNApSAcK
C00119	KEGG COMPOUND
DB01632	DrugBank
HMDB0000280	HMDB
PRP	PDBeChem
PRPP	MetaCyc
View more database links

Registry Numbers	Types	Sources
60403	Reaxys Registry Number	Reaxys
7540-64-9	CAS Registry Number	ChemIDplus

Citations	Types	Sources
22264286	PubMed citation	Europe PMC
23509005	PubMed citation	Europe PMC
23734909	PubMed citation	Europe PMC

Last Modified

27 January 2016

CHEBI:17111 - 5-O-phosphono-α-D-ribofuranosyl diphosphate

ChEBI is part of the ELIXIR infrastructure