progesterone (CHEBI:17026)

ChEBI > Main

CHEBI:17026 - progesterone

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	progesterone

ChEBI ID	CHEBI:17026

Definition	A C₂₁-steroid hormone in which a pregnane skeleton carries oxo substituents at positions 3 and 20 and is unsaturated at C(4)-C(5). As a hormone, it is involved in the female menstrual cycle, pregnancy and embryogenesis of humans and other species.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:18798, CHEBI:45786, CHEBI:14896, CHEBI:26269, CHEBI:439, CHEBI:8453, CHEBI:28589

Supplier Information	ChemicalBook:CB4224484, ChemicalBook:CB15477619, eMolecules:511682, eMolecules:29549914, Selleckchem:Progesterone(Prometrium), ZINC000004428529

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__33192023777206314__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__33192023777206314__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:17026","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__33192023777206314__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"33192023777206314","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__33192023777206314__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 10020614503D

starting HoverWatcher_5

Time for openFile(

Marvin 10020614503D

53 56 0 0 1 0 999 V2000

0.7282 -2.1900 -0.8476 C 0 0 0 0 0 0 0 0 0 7 0 0

-0.0375 -3.3229 -0.1234 C 0 0 0 0 0 0 0 0 0 6 0 0

-1.4523 -2.9764 0.0923 C 0 0 0 0 0 0 0 0 0 5 0 0

-2.3942 -3.8376 -0.3548 C 0 0 0 0 0 0 0 0 0 4 0 0

-4.2759 -2.5954 0.6076 C 0 0 0 0 0 0 0 0 0 2 0 0

-3.3377 -1.3604 0.6361 C 0 0 0 0 0 0 0 0 0 1 0 0

-1.7918 -1.6851 0.7736 C 0 0 2 0 0 0 0 0 0 10 0 0

-0.2665 2.0802 0.1693 C 0 0 0 0 0 0 0 0 0 12 0 0

3.1702 1.7281 -1.5838 C 0 0 0 0 0 0 0 0 0 16 0 0

2.7616 0.2665 -1.2888 C 0 0 0 0 0 0 0 0 0 15 0 0

-0.9439 -0.5010 0.1235 C 0 0 2 0 0 0 0 0 0 9 0 0

-1.3357 -0.3922 -0.8960 H 0 0 0 0 0 0 0 0 0 0 0 0

1.2960 0.3693 -0.8102 C 0 0 1 0 0 0 0 0 0 14 0 0

0.7346 0.4964 -1.7485 H 0 0 0 0 0 0 0 0 0 0 0 0

0.5801 -0.8320 -0.1033 C 0 0 2 0 0 0 0 0 0 8 0 0

1.0605 -0.9908 0.8636 H 0 0 0 0 0 0 0 0 0 0 0 0

1.2490 1.7091 0.0067 C 0 0 1 0 0 0 0 0 0 13 0 0

2.0734 2.6395 -0.9599 C 0 0 1 0 0 0 0 0 0 17 0 0

-3.7305 -3.6448 -0.2296 C 0 0 0 0 0 0 0 0 0 3 0 0

-4.5059 -4.3799 -0.8281 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.1442 0.9277 0.7478 C 0 0 0 0 0 0 0 0 0 11 0 0

2.6115 3.9347 -0.5309 C 0 0 0 0 0 0 0 0 0 20 0 0

3.4454 3.9788 0.3651 O 0 0 0 0 0 0 0 0 0 0 0 0

1.3886 2.8602 -1.7876 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.5017 -1.8526 2.3075 C 0 0 0 0 0 0 0 0 0 19 0 0

-0.4517 -2.0478 2.5273 H 0 0 0 0 0 0 0 0 0 0 0 0

1.8905 1.6311 1.4396 C 0 0 0 0 0 0 0 0 0 18 0 0

2.9469 1.3632 1.4136 H 0 0 0 0 0 0 0 0 0 0 0 0

2.2606 5.1998 -1.1490 C 0 0 0 0 0 0 0 0 0 21 0 0

1.4117 5.6351 -0.6210 H 0 0 0 0 0 0 0 0 0 0 0 0

0.3543 -2.1063 -1.8727 H 0 0 0 0 0 0 0 0 0 0 0 0

1.7825 -2.4740 -0.9144 H 0 0 0 0 0 0 0 0 0 0 0 0

0.4346 -3.5347 0.8391 H 0 0 0 0 0 0 0 0 0 0 0 0

0.1202 -4.2318 -0.7149 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.1155 -4.6770 -0.8153 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.2625 -2.2856 0.2471 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.4178 -3.0008 1.6128 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.6930 -0.6864 1.4218 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.5336 -0.8318 -0.3011 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.3698 2.9619 0.8096 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.6937 2.3762 -0.7929 H 0 0 0 0 0 0 0 0 0 0 0 0

3.2349 1.9077 -2.6624 H 0 0 0 0 0 0 0 0 0 0 0 0

4.1702 1.9094 -1.1785 H 0 0 0 0 0 0 0 0 0 0 0 0

3.3935 -0.1631 -0.5075 H 0 0 0 0 0 0 0 0 0 0 0 0

2.8653 -0.3561 -2.1821 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.1876 1.2340 0.6402 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.9532 0.8917 1.8189 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.0840 -2.6675 2.7433 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.7714 -0.9633 2.8795 H 0 0 0 0 0 0 0 0 0 0 0 0

1.4029 0.9084 2.0930 H 0 0 0 0 0 0 0 0 0 0 0 0

1.8064 2.5899 1.9546 H 0 0 0 0 0 0 0 0 0 0 0 0

3.0884 5.9134 -1.1301 H 0 0 0 0 0 0 0 0 0 0 0 0

1.9895 5.0749 -2.1990 H 0 0 0 0 0 0 0 0 0 0 0 0

15 1 1 0 0 0 0

15 11 1 0 0 0 0

15 13 1 0 0 0 0

1 2 1 0 0 0 0

2 3 1 0 0 0 0

3 4 2 0 0 0 0

3 7 1 0 0 0 0

4 19 1 0 0 0 0

19 5 1 0 0 0 0

5 6 1 0 0 0 0

6 7 1 0 0 0 0

7 11 1 0 0 0 0

11 21 1 0 0 0 0

21 8 1 0 0 0 0

8 17 1 0 0 0 0

17 18 1 0 0 0 0

17 13 1 0 0 0 0

18 9 1 0 0 0 0

9 10 1 0 0 0 0

10 13 1 0 0 0 0

11 12 1 0 0 0 0

13 14 1 0 0 0 0

15 16 1 0 0 0 0

18 24 1 0 0 0 0

18 22 1 0 0 0 0

19 20 2 0 0 0 0

22 23 2 0 0 0 0

7 25 1 0 0 0 0

17 27 1 0 0 0 0

22 29 1 0 0 0 0

25 26 1 0 0 0 0

27 28 1 0 0 0 0

29 30 1 0 0 0 0

1 31 1 0 0 0 0

1 32 1 0 0 0 0

2 33 1 0 0 0 0

2 34 1 0 0 0 0

4 35 1 0 0 0 0

5 36 1 0 0 0 0

5 37 1 0 0 0 0

6 38 1 0 0 0 0

6 39 1 0 0 0 0

8 40 1 0 0 0 0

8 41 1 0 0 0 0

9 42 1 0 0 0 0

9 43 1 0 0 0 0

10 44 1 0 0 0 0

10 45 1 0 0 0 0

21 46 1 0 0 0 0

21 47 1 0 0 0 0

25 48 1 0 0 0 0

25 49 1 0 0 0 0

27 50 1 0 0 0 0

27 51 1 0 0 0 0

29 52 1 0 0 0 0

29 53 1 0 0 0 0

M END): 22 ms

reading 53 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

53 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Molfile

Wikipedia	License
Progesterone ( ; P4) is an endogenous steroid and progestogen sex hormone involved in the menstrual cycle, pregnancy, and embryogenesis of humans and other species. It belongs to a group of steroid hormones called the progestogens and is the major progestogen in the body. Progesterone has a variety of important functions in the body. It is also a crucial metabolic intermediate in the production of other endogenous steroids, including the sex hormones and the corticosteroids, and plays an important role in brain function as a neurosteroid. In addition to its role as a natural hormone, progesterone is also used as a medication, such as in combination with estrogen for contraception, to reduce the risk of uterine or cervical cancer, in hormone replacement therapy, and in feminizing hormone therapy. It was first prescribed in 1934.
Read full article at Wikipedia

Formula

C21H30O2

Net Charge

Average Mass

314.46170

Monoisotopic Mass

314.22458

InChI

InChI=1S/C21H30O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h12,16-19H,4-11H2,1-3H3/t16-,17+,18-,19-,20-,21+/m0/s1

InChIKey

RJKFOVLPORLFTN-LEKSSAKUSA-N

SMILES

[H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@H](CC[C@@]21[H])C(C)=O

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed
Homo sapiens (NCBI:txid9606)	See: DOI

Roles Classification
Biological Role(s):	progestin A synthetic progestogen. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). progesterone receptor agonist A hormone agonist that binds to and activates progesterone receptors. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. (via steroid hormone )

Application(s):	contraceptive drug A chemical substance that prevents or reduces the probability of conception. progesterone receptor agonist A hormone agonist that binds to and activates progesterone receptors.

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	progesterone (CHEBI:17026) has parent hydride pregnane (CHEBI:8386) progesterone (CHEBI:17026) has role contraceptive drug (CHEBI:49323) progesterone (CHEBI:17026) has role human metabolite (CHEBI:77746) progesterone (CHEBI:17026) has role mouse metabolite (CHEBI:75771) progesterone (CHEBI:17026) has role progesterone receptor agonist (CHEBI:70709) progesterone (CHEBI:17026) has role progestin (CHEBI:59826) progesterone (CHEBI:17026) is a 20-oxo steroid (CHEBI:36885) progesterone (CHEBI:17026) is a 3-oxo-Δ⁴ steroid (CHEBI:47909) progesterone (CHEBI:17026) is a C₂₁-steroid hormone (CHEBI:64600)

Incoming	Δ¹-progesterone (CHEBI:34073) has functional parent progesterone (CHEBI:17026) 11α-hydroxyprogesterone (CHEBI:16076) has functional parent progesterone (CHEBI:17026) 11β-hydroxyprogesterone (CHEBI:28247) has functional parent progesterone (CHEBI:17026) 11,21-dioxoprogesterone (CHEBI:78601) has functional parent progesterone (CHEBI:17026) 11-deoxycorticosterone (CHEBI:16973) has functional parent progesterone (CHEBI:17026) 12α-hydroxyprogesterone (CHEBI:34153) has functional parent progesterone (CHEBI:17026) 15β-hydroxyprogesterone (CHEBI:59418) has functional parent progesterone (CHEBI:17026) 16α-hydroxyprogesterone (CHEBI:15826) has functional parent progesterone (CHEBI:17026) 16β-methylpregn-4-ene-3,20-dione (CHEBI:79767) has functional parent progesterone (CHEBI:17026) 16,17-didehydroprogesterone (CHEBI:18204) has functional parent progesterone (CHEBI:17026) 17α-hydroxyprogesterone (CHEBI:17252) has functional parent progesterone (CHEBI:17026) 2,5-dioxo-1-pyrrolidinyl 6-(6-{3-[(progesterone-4-yl)thiopropionyl]aminohexanoyl}amino)hexanoate (CHEBI:62026) has functional parent progesterone (CHEBI:17026) 21-dehydrocortisol (CHEBI:78595) has functional parent progesterone (CHEBI:17026) 21-dehydrocortisone (CHEBI:78596) has functional parent progesterone (CHEBI:17026) 3-(progesterone-4-yl)thiopropionic acid (CHEBI:62022) has functional parent progesterone (CHEBI:17026) 3-(progesterone-7α-yl)thiopropionic acid (CHEBI:62023) has functional parent progesterone (CHEBI:17026) 4-pregnen-3β,20α-diol (CHEBI:85903) has functional parent progesterone (CHEBI:17026) 4-pregnen-3β-ol-20-one (CHEBI:85899) has functional parent progesterone (CHEBI:17026) 5α-pregnane-3,20-dione (CHEBI:28952) has functional parent progesterone (CHEBI:17026) 6β,16α,17α-trihydroxyprogesterone (CHEBI:137046) has functional parent progesterone (CHEBI:17026) 6-(6-{3-[(progesterone-4-yl)thiopropionyl]aminohexanoyl}amino)hexanoic acid (CHEBI:62025) has functional parent progesterone (CHEBI:17026) 6-{3-[(progesterone-4-yl)thiopropionyl]amino}hexanoic acid (CHEBI:62024) has functional parent progesterone (CHEBI:17026) 9-fluoro-2α-methylpregn-4-ene-3,11,20-trione (CHEBI:79773) has functional parent progesterone (CHEBI:17026) progesterone 3-O-(carboxymethyl)oxime (CHEBI:62042) has functional parent progesterone (CHEBI:17026)

IUPAC Name

pregn-4-ene-3,20-dione

Synonyms	Sources
(S)-4-Pregnene-3,20-dione	KEGG COMPOUND
(S)-Pregn-4-en-3,20-dione	KEGG COMPOUND
(S)-Progesterone	KEGG COMPOUND
17α-progesterone	NIST Chemistry WebBook
4-Pregnene-3,20-dione	KEGG COMPOUND
Agolutin	NIST Chemistry WebBook
Akrolutin	ChEBI
corpus luteum hormone	ChemIDplus
Crinone	ChemIDplus
Δ⁴-pregnene-3,20-dione	ChEBI
Gelbkörperhormon	ChEBI
luteohormone	ChemIDplus
Progesteron	ChEBI
Progesterone	KEGG COMPOUND
PROGESTERONE	PDBeChem
progesterone	UniProt

Manual Xrefs	Databases
2279	DrugCentral
C00410	KEGG COMPOUND
D00066	KEGG DRUG
DB00396	DrugBank
HMDB0001830	HMDB
Progesterone	Wikipedia
PROGESTERONE	MetaCyc
STR	PDBeChem
View more database links

Registry Numbers	Types	Sources
1915950	Reaxys Registry Number	Reaxys
57-83-0	CAS Registry Number	KEGG COMPOUND
57-83-0	CAS Registry Number	NIST Chemistry WebBook
57-83-0	CAS Registry Number	ChemIDplus
708590	Gmelin Registry Number	Gmelin

Citations

Ball WJ, Kasturi R, Dey P, Tabet M, O'Donnell S, Hudson D, Fishwild D (1999)
Isolation and characterization of human monoclonal antibodies to digoxin.
Journal of immunology (Baltimore, Md. : 1950) 163, 2291-2298 [PubMed:10438974]
[show Abstract]

Romesberg FE, Spiller B, Schultz PG, Stevens RC (1998)
Immunological origins of binding and catalysis in a Diels-Alderase antibody.
Science (New York, N.Y.) 279, 1929-1933 [PubMed:9506942]
[show Abstract]

Last Modified

22 February 2017

CHEBI:17026 - progesterone

ChEBI is part of the ELIXIR infrastructure