corticosterone (CHEBI:16827)

ChEBI > Main

CHEBI:16827 - corticosterone

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	corticosterone

ChEBI ID	CHEBI:16827

Definition	A 21-hydroxy steroid that consists of pregn-4-ene substituted by hydroxy groups at positions 11 and 21 and oxo groups at positions 3 and 20. Corticosterone is a 21-carbon steroid hormone of the corticosteroid type produced in the cortex of the adrenal glands.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:41361, CHEBI:3891, CHEBI:14022, CHEBI:19131, CHEBI:57911

Supplier Information	ChemicalBook:CB7418589, eMolecules:493533, ZINC000013513592

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__318268379542354__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__318268379542354__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:16827","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__318268379542354__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"318268379542354","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__318268379542354__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

Marvin 10020613273D

starting HoverWatcher_5

Time for openFile(

Marvin 10020613273D

55 58 0 0 1 0 999 V2000

-2.4195 -1.3225 0.2267 C 0 0 2 0 0 0 0 0 0 0 0 0

-2.1956 -2.7949 0.3854 C 0 0 0 0 0 0 0 0 0 0 0 0

-3.5107 -1.0161 -0.8836 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.9807 -3.7214 -0.2092 C 0 0 0 0 0 0 0 0 0 0 0 0

-4.6206 -2.0899 -1.0071 C 0 0 0 0 0 0 0 0 0 0 0 0

-4.0544 -3.4248 -0.9808 C 0 0 0 0 0 0 0 0 0 0 0 0

0.2386 -1.1695 0.5504 C 0 0 2 0 0 0 0 0 0 0 0 0

0.2702 -2.7190 0.6260 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.0450 -0.6392 -0.1997 C 0 0 2 0 0 0 0 0 0 0 0 0

-1.0598 -3.2616 1.1954 C 0 0 0 0 0 0 0 0 0 0 0 0

1.5485 1.0124 0.0367 C 0 0 2 0 0 0 0 0 0 0 0 0

1.5348 -0.5480 -0.0749 C 0 0 1 0 0 0 0 0 0 0 0 0

0.3254 1.5121 -0.8123 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.0450 0.9277 -0.3572 C 0 0 2 0 0 0 0 0 0 0 0 0

3.8652 0.1346 -0.2051 C 0 0 0 0 0 0 0 0 0 0 0 0

2.9493 -0.9658 0.3819 C 0 0 0 0 0 0 0 0 0 0 0 0

2.9596 1.3568 -0.5647 C 0 0 2 0 0 0 0 0 0 0 0 0

-4.5701 -4.3024 -1.6600 O 0 0 0 0 0 0 0 0 0 0 0 0

-2.9932 -0.7892 1.5881 C 0 0 0 0 0 0 0 0 0 0 0 0

1.4580 1.5438 1.5193 C 0 0 0 0 0 0 0 0 0 0 0 0

3.4979 2.6803 -0.2236 C 0 0 0 0 0 0 0 0 0 0 0 0

3.1989 3.8872 -0.9665 C 0 0 0 0 0 0 0 0 0 0 0 0

3.8295 3.8329 -2.2379 O 0 0 0 0 0 0 0 0 0 0 0 0

4.1589 2.8185 0.7981 O 0 0 0 0 0 0 0 0 0 0 0 0

-1.4545 1.6262 0.8160 O 0 0 0 0 0 0 0 0 0 0 0 0

0.1683 -0.8747 1.5965 H 0 0 0 0 0 0 0 0 0 0 0 0

1.5155 -0.8534 -1.1329 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.8729 -0.9924 -1.2245 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.0582 -0.9534 -1.8779 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.9915 -0.0436 -0.7386 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.7714 -4.6885 -0.0929 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.1959 -1.9192 -1.9228 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.3150 -2.0020 -0.1686 H 0 0 0 0 0 0 0 0 0 0 0 0

1.0865 -3.0443 1.2783 H 0 0 0 0 0 0 0 0 0 0 0 0

0.4538 -3.1519 -0.3617 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.9610 -4.3496 1.2634 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.1806 -2.9350 2.2314 H 0 0 0 0 0 0 0 0 0 0 0 0

0.2692 2.6017 -0.8053 H 0 0 0 0 0 0 0 0 0 0 0 0

0.4593 1.2408 -1.8654 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.7831 1.2155 -1.1107 H 0 0 0 0 0 0 0 0 0 0 0 0

4.6510 0.3637 0.5189 H 0 0 0 0 0 0 0 0 0 0 0 0

4.3782 -0.2371 -1.0988 H 0 0 0 0 0 0 0 0 0 0 0 0

3.2350 -1.9580 0.0204 H 0 0 0 0 0 0 0 0 0 0 0 0

3.0093 -0.9850 1.4726 H 0 0 0 0 0 0 0 0 0 0 0 0

2.8764 1.3331 -1.6588 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.3269 0.2471 1.5310 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.2650 -0.8301 2.3991 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.8759 -1.3491 1.9045 H 0 0 0 0 0 0 0 0 0 0 0 0

1.4080 2.6330 1.5366 H 0 0 0 0 0 0 0 0 0 0 0 0

2.3199 1.2407 2.1147 H 0 0 0 0 0 0 0 0 0 0 0 0

0.5938 1.2129 2.0860 H 0 0 0 0 0 0 0 0 0 0 0 0

3.5457 4.7889 -0.4538 H 0 0 0 0 0 0 0 0 0 0 0 0

2.1245 4.0021 -1.1054 H 0 0 0 0 0 0 0 0 0 0 0 0

3.5737 4.6703 -2.6770 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.4065 2.5815 0.6004 H 0 0 0 0 0 0 0 0 0 0 0 0

3 1 1 0 0 0 0

4 2 2 0 0 0 0

5 3 1 0 0 0 0

6 4 1 0 0 0 0

6 5 1 0 0 0 0

8 7 1 0 0 0 0

10 8 1 0 0 0 0

1 9 1 0 0 0 0

2 10 1 0 0 0 0

2 1 1 0 0 0 0

13 11 1 0 0 0 0

7 12 1 0 0 0 0

14 13 1 0 0 0 0

9 7 1 0 0 0 0

9 14 1 0 0 0 0

16 15 1 0 0 0 0

17 15 1 0 0 0 0

11 17 1 0 0 0 0

12 11 1 0 0 0 0

12 16 1 0 0 0 0

18 6 2 0 0 0 0

1 19 1 0 0 0 0

11 20 1 0 0 0 0

17 21 1 0 0 0 0

22 21 1 0 0 0 0

23 22 1 0 0 0 0

24 21 2 0 0 0 0

14 25 1 0 0 0 0

7 26 1 0 0 0 0

12 27 1 0 0 0 0

9 28 1 0 0 0 0

3 29 1 0 0 0 0

3 30 1 0 0 0 0

4 31 1 0 0 0 0

5 32 1 0 0 0 0

5 33 1 0 0 0 0

8 34 1 0 0 0 0

8 35 1 0 0 0 0

10 36 1 0 0 0 0

10 37 1 0 0 0 0

13 38 1 0 0 0 0

13 39 1 0 0 0 0

14 40 1 0 0 0 0

15 41 1 0 0 0 0

15 42 1 0 0 0 0

16 43 1 0 0 0 0

16 44 1 0 0 0 0

17 45 1 0 0 0 0

19 46 1 0 0 0 0

19 47 1 0 0 0 0

19 48 1 0 0 0 0

20 49 1 0 0 0 0

20 50 1 0 0 0 0

20 51 1 0 0 0 0

22 52 1 0 0 0 0

22 53 1 0 0 0 0

23 54 1 0 0 0 0

25 55 1 0 0 0 0

M END): 25 ms

reading 55 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

55 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Molfile

Wikipedia	License
Corticosterone, also known as 17-deoxycortisol and 11β,21-dihydroxyprogesterone, is a 21-carbon steroid hormone of the corticosteroid type produced in the cortex of the adrenal glands. In the very rare case of congenital adrenal hyperplasia due to 17α-hydroxylase deficiency cortisol production is blocked.
Read full article at Wikipedia

Formula

C21H30O4

Net Charge

Average Mass

346.46050

Monoisotopic Mass

346.21441

InChI

InChI=1S/C21H30O4/c1-20-8-7-13(23)9-12(20)3-4-14-15-5-6-16(18(25)11-22)21(15,2)10-17(24)19(14)20/h9,14-17,19,22,24H,3-8,10-11H2,1-2H3/t14-,15-,16+,17-,19+,20-,21-/m0/s1

InChIKey

OMFXVFTZEKFJBZ-HJTSIMOOSA-N

SMILES

[H][C@@]1(CC[C@@]2([H])[C@]3([H])CCC4=CC(=O)CC[C@]4(C)[C@@]3([H])[C@@H](O)C[C@]12C)C(=O)CO

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed
Homo sapiens (NCBI:txid9606)	See: DOI
Homo sapiens (NCBI:txid9606)	Found in blood serum (BTO:0000133). See: MetaboLights Study

Roles Classification
Biological Role(s):	human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. (via steroid hormone )

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	corticosterone (CHEBI:16827) has parent hydride pregnane (CHEBI:8386) corticosterone (CHEBI:16827) has role human metabolite (CHEBI:77746) corticosterone (CHEBI:16827) has role mouse metabolite (CHEBI:75771) corticosterone (CHEBI:16827) is a 11β-hydroxy steroid (CHEBI:35346) corticosterone (CHEBI:16827) is a 20-oxo steroid (CHEBI:36885) corticosterone (CHEBI:16827) is a 21-hydroxy steroid (CHEBI:35344) corticosterone (CHEBI:16827) is a 3-oxo-Δ⁴ steroid (CHEBI:47909) corticosterone (CHEBI:16827) is a C₂₁-steroid (CHEBI:61313) corticosterone (CHEBI:16827) is a glucocorticoid (CHEBI:24261) corticosterone (CHEBI:16827) is a primary α-hydroxy ketone (CHEBI:139590)

Incoming	11-dehydrocorticosterone (CHEBI:78600) has functional parent corticosterone (CHEBI:16827) 11-deoxycorticosterone pivalate (CHEBI:50782) has functional parent corticosterone (CHEBI:16827) 18-hydroxycorticosterone (CHEBI:16485) has functional parent corticosterone (CHEBI:16827) 20β-dihydrocorticosterone (CHEBI:189050) has functional parent corticosterone (CHEBI:16827) 5α-dihydrocorticosterone (CHEBI:180474) has functional parent corticosterone (CHEBI:16827) 5β-dihydrocorticosterone (CHEBI:86381) has functional parent corticosterone (CHEBI:16827)

IUPAC Name

11β,21-dihydroxypregn-4-ene-3,20-dione

Synonyms	Sources
(11β)-11,21-dihydroxypregn-4-ene-3,20-dione	NIST Chemistry WebBook
11beta,21-Dihydroxy-4-pregnene-3,20-dione	KEGG COMPOUND
11β,21-dihydroxyprogesterone	NIST Chemistry WebBook
17-deoxycortisol	ChemIDplus
Corticosterone	KEGG COMPOUND
CORTICOSTERONE	PDBeChem
corticosterone	UniProt
Kendall's compound B	KEGG COMPOUND
Reichstein's substance H	KEGG COMPOUND

Manual Xrefs	Databases
C02140	KEGG COMPOUND
C0R	PDBeChem
Corticosterone	Wikipedia
CORTICOSTERONE	MetaCyc
HMDB0001547	HMDB
LMST02030186	LIPID MAPS
LSM-5814	LINCS
View more database links

Registry Numbers	Types	Sources
2339601	Beilstein Registry Number	ChemIDplus
50-22-6	CAS Registry Number	ChemIDplus
50-22-6	CAS Registry Number	NIST Chemistry WebBook

Citations

Thorpe JB, Gould KE, Borman ED, deCatanzaro D (2014)
Circulating and urinary adrenal corticosterone, progesterone, and estradiol in response to acute stress in female mice (Mus musculus).
Hormone and metabolic research = Hormon- und Stoffwechselforschung = Hormones et metabolisme 46, 211-218 [PubMed:24446162]
[show Abstract]

Raubenheimer PJ, Young EA, Andrew R, Seckl JR (2006)
The role of corticosterone in human hypothalamic-pituitary-adrenal axis feedback.
Clinical endocrinology 65, 22-26 [PubMed:16817814]
[show Abstract]

Nuller YL, Morozova MG, Kushnir ON, Hamper N (2001)
Effect of naloxone therapy on depersonalization: a pilot study.
Journal of psychopharmacology (Oxford, England) 15, 93-95 [PubMed:11448093]
[show Abstract]

Ball WJ, Kasturi R, Dey P, Tabet M, O'Donnell S, Hudson D, Fishwild D (1999)
Isolation and characterization of human monoclonal antibodies to digoxin.
Journal of immunology (Baltimore, Md. : 1950) 163, 2291-2298 [PubMed:10438974]
[show Abstract]

Last Modified

06 February 2018

ChEBI

CHEBI:16827 - corticosterone

Objective

Design

Participants

Measurements

Results

Conclusions

ChEBI is part of the ELIXIR infrastructure