prostaglandin E(2) (CHEBI:15551)

ChEBI > Main

CHEBI:15551 - prostaglandin E₂

Main

ChEBI Ontology

Automatic Xrefs

Reactions

Pathways

Models

ChEBI Name	prostaglandin E₂

ChEBI ID	CHEBI:15551

ChEBI ASCII Name	prostaglandin E2

Definition	Prostaglandin F_2α in which the hydroxy group at position 9 has been oxidised to the corresponding ketone. Prostaglandin E₂ is the most common and most biologically potent of mammalian prostaglandins.

Stars	This entity has been manually annotated by the ChEBI Team.

Secondary ChEBI IDs	CHEBI:26323, CHEBI:10910, CHEBI:10911, CHEBI:4625, CHEBI:114125, CHEBI:8512

Supplier Information	ChemicalBook:CB8112259, eMolecules:478458, ZINC000004474696

Download	Molfile XML SDF

more structures >>

call loadScript javascripts\jsmol\core\package.js

call loadScript javascripts\jsmol\core\core.z.js -- required by ClazzNode

call loadScript javascripts\jsmol\J\awtjs2d\WebOutputChannel.js

Jmol JavaScript applet jmolApplet0_object__212087248680815__ initializing

getValue debug = null

getValue logLevel = null

getValue allowjavascript = null

AppletRegistry.checkIn(jmolApplet0_object__212087248680815__)

call loadScript javascripts\jsmol\core\corestate.z.js

viewerOptions:

{ "name":"jmolApplet0_object","applet":true,"documentBase":"https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:15551","platform":"J.awtjs2d.Platform","fullName":"jmolApplet0_object__212087248680815__","display":"jmolApplet0_canvas2d","signedApplet":"true","appletReadyCallback":"Jmol._readyCallback","statusListener":"[J.appletjs.Jmol.MyStatusListener object]","codeBase":"https://www.ebi.ac.uk/chebi/javascripts/jsmol/","syncId":"212087248680815","bgcolor":"#000" }

Jmol Version: 13.2.7 $Date: 2013-10-01 11:35:15 -0500 (Tue, 01 Oct 2013) $

java.vendor: j2s

java.version: 0.0

os.name: j2s

Access: ALL

memory: 0.0/0.0

processors available: 1

useCommandThread: false

appletId:jmolApplet0_object (signed)

starting HoverWatcher_1

getValue emulate = null

defaults = "Jmol"

getValue boxbgcolor = null

getValue bgcolor = #000

backgroundColor = "#000"

getValue ANIMFRAMECallback = null

getValue APPLETREADYCallback = Jmol._readyCallback

APPLETREADYCallback = "Jmol._readyCallback"

getValue ATOMMOVEDCallback = null

getValue CLICKCallback = null

getValue ECHOCallback = null

getValue ERRORCallback = null

getValue EVALCallback = null

getValue HOVERCallback = null

getValue LOADSTRUCTCallback = null

getValue MEASURECallback = null

getValue MESSAGECallback = null

getValue MINIMIZATIONCallback = null

getValue PICKCallback = null

getValue RESIZECallback = null

getValue SCRIPTCallback = null

getValue SYNCCallback = null

getValue STRUCTUREMODIFIEDCallback = null

getValue doTranslate = null

language=en_US

getValue popupMenu = null

getValue script = null

Jmol applet jmolApplet0_object__212087248680815__ ready

call loadScript javascripts\jsmol\core\corescript.z.js

call loadScript javascripts\jsmol\J\script\FileLoadThread.js

starting QueueThread0_2

script 1 started

starting HoverWatcher_3

starting HoverWatcher_4

The Resolver thinks Mol

P2E - Ideal conformer

Mrv1927 06092115523D

starting HoverWatcher_5

Time for openFile(P2E - Ideal conformer

Mrv1927 06092115523D

57 57 0 0 0 0 999 V2000

3.9310 3.0420 0.0320 C 0 0 1 0 0 0 0 0 0 0 0 0

4.4680 1.6530 -0.3230 C 0 0 1 0 0 0 0 0 0 0 0 0

3.3120 0.7620 -0.7820 C 0 0 1 0 0 0 0 0 0 0 0 0

3.8410 -0.6060 -1.1310 C 0 0 0 0 0 0 0 0 0 0 0 0

3.2990 -1.6730 -0.5990 C 0 0 0 0 0 0 0 0 0 0 0 0

2.0440 -1.5490 0.2270 C 0 0 1 0 0 0 0 0 0 0 0 0

0.9780 -2.5000 -0.3200 C 0 0 1 0 0 0 0 0 0 0 0 0

1.4100 -3.9370 -0.1110 C 0 0 0 0 0 0 0 0 0 0 0 0

2.3970 -4.4610 -0.5690 O 0 0 0 0 0 0 0 0 0 0 0 0

-0.3430 -2.3130 0.4550 C 0 0 2 0 0 0 0 0 0 0 0 0

-0.9090 -3.7520 0.5700 C 0 0 2 0 0 0 0 0 0 0 0 0

-1.7830 -3.8650 1.6950 O 0 0 0 0 0 0 0 0 0 0 0 0

0.3720 -4.5960 0.7800 C 0 0 1 0 0 0 0 0 0 0 0 0

-1.2900 -1.4320 -0.3170 C 0 0 0 0 0 0 0 0 0 0 0 0

-1.7130 -0.3080 0.2060 C 0 0 0 0 0 0 0 0 0 0 0 0

-2.6600 0.5740 -0.5660 C 0 0 1 0 0 0 0 0 0 0 0 0

-3.0370 -0.0800 -1.7790 O 0 0 0 0 0 0 0 0 0 0 0 0

-3.9080 0.8440 0.2770 C 0 0 1 0 0 0 0 0 0 0 0 0

-4.8120 1.8380 -0.4540 C 0 0 1 0 0 0 0 0 0 0 0 0

-6.0600 2.1090 0.3890 C 0 0 1 0 0 0 0 0 0 0 0 0

-6.9640 3.1030 -0.3420 C 0 0 1 0 0 0 0 0 0 0 0 0

-8.2120 3.3730 0.5010 C 0 0 0 0 0 0 0 0 0 0 0 0

6.1940 3.4800 0.5190 O 0 0 0 0 0 0 0 0 0 0 0 0

5.0690 3.9190 0.4840 C 0 0 0 0 0 0 0 0 0 0 0 0

4.8340 5.1900 0.8480 O 0 0 0 0 0 0 0 0 0 0 0 0

3.4580 3.4830 -0.8450 H 0 0 0 0 0 0 0 0 0 0 0 0

3.1990 2.9540 0.8340 H 0 0 0 0 0 0 0 0 0 0 0 0

5.2000 1.7410 -1.1250 H 0 0 0 0 0 0 0 0 0 0 0 0

4.9410 1.2120 0.5540 H 0 0 0 0 0 0 0 0 0 0 0 0

2.5800 0.6740 0.0200 H 0 0 0 0 0 0 0 0 0 0 0 0

2.8390 1.2030 -1.6590 H 0 0 0 0 0 0 0 0 0 0 0 0

4.6660 -0.7060 -1.8210 H 0 0 0 0 0 0 0 0 0 0 0 0

3.7510 -2.6420 -0.7520 H 0 0 0 0 0 0 0 0 0 0 0 0

2.2640 -1.8060 1.2630 H 0 0 0 0 0 0 0 0 0 0 0 0

1.6760 -0.5240 0.1770 H 0 0 0 0 0 0 0 0 0 0 0 0

0.8180 -2.3100 -1.3810 H 0 0 0 0 0 0 0 0 0 0 0 0

-0.1510 -1.8970 1.4440 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.4220 -4.0410 -0.3470 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.1630 -4.7470 1.8100 H 0 0 0 0 0 0 0 0 0 0 0 0

0.2040 -5.6270 0.4690 H 0 0 0 0 0 0 0 0 0 0 0 0

0.6870 -4.5580 1.8230 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.6200 -1.7260 -1.3030 H 0 0 0 0 0 0 0 0 0 0 0 0

-1.3830 -0.0130 1.1920 H 0 0 0 0 0 0 0 0 0 0 0 0

-2.1680 1.5180 -0.8000 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.4810 -0.9280 -1.6470 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.4480 -0.0890 0.4360 H 0 0 0 0 0 0 0 0 0 0 0 0

-3.6120 1.2620 1.2400 H 0 0 0 0 0 0 0 0 0 0 0 0

-4.2720 2.7720 -0.6130 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.1070 1.4210 -1.4170 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.6000 1.1750 0.5480 H 0 0 0 0 0 0 0 0 0 0 0 0

-5.7640 2.5260 1.3520 H 0 0 0 0 0 0 0 0 0 0 0 0

-6.4240 4.0360 -0.5010 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.2590 2.6850 -1.3050 H 0 0 0 0 0 0 0 0 0 0 0 0

-8.7520 2.4390 0.6600 H 0 0 0 0 0 0 0 0 0 0 0 0

-7.9170 3.7900 1.4640 H 0 0 0 0 0 0 0 0 0 0 0 0

-8.8560 4.0810 -0.0200 H 0 0 0 0 0 0 0 0 0 0 0 0

5.5950 5.7140 1.1310 H 0 0 0 0 0 0 0 0 0 0 0 0

1 2 1 0 0 0 0

1 24 1 0 0 0 0

2 3 1 0 0 0 0

3 4 1 0 0 0 0

4 5 2 0 0 0 0

5 6 1 0 0 0 0

6 7 1 0 0 0 0

7 8 1 0 0 0 0

7 10 1 0 0 0 0

8 9 2 0 0 0 0

8 13 1 0 0 0 0

10 11 1 0 0 0 0

10 14 1 0 0 0 0

11 12 1 0 0 0 0

11 13 1 0 0 0 0

14 15 2 0 0 0 0

15 16 1 0 0 0 0

16 17 1 0 0 0 0

16 18 1 0 0 0 0

18 19 1 0 0 0 0

19 20 1 0 0 0 0

20 21 1 0 0 0 0

21 22 1 0 0 0 0

23 24 2 0 0 0 0

24 25 1 0 0 0 0

1 26 1 0 0 0 0

1 27 1 0 0 0 0

2 28 1 0 0 0 0

2 29 1 0 0 0 0

3 30 1 0 0 0 0

3 31 1 0 0 0 0

4 32 1 0 0 0 0

5 33 1 0 0 0 0

6 34 1 0 0 0 0

6 35 1 0 0 0 0

7 36 1 6 0 0 0

10 37 1 1 0 0 0

11 38 1 6 0 0 0

12 39 1 0 0 0 0

13 40 1 0 0 0 0

13 41 1 0 0 0 0

14 42 1 0 0 0 0

15 43 1 0 0 0 0

16 44 1 6 0 0 0

17 45 1 0 0 0 0

18 46 1 0 0 0 0

18 47 1 0 0 0 0

19 48 1 0 0 0 0

19 49 1 0 0 0 0

20 50 1 0 0 0 0

20 51 1 0 0 0 0

21 52 1 0 0 0 0

21 53 1 0 0 0 0

22 54 1 0 0 0 0

22 55 1 0 0 0 0

22 56 1 0 0 0 0

25 57 1 0 0 0 0

M END): 33 ms

reading 57 atoms

ModelSet: haveSymmetry:false haveUnitcells:false haveFractionalCoord:false

1 model in this collection. Use getProperty "modelInfo" or getProperty "auxiliaryInfo" to inspect them.

Default Van der Waals type for model set to Babel

57 atoms created

ModelSet: not autobonding; use forceAutobond=true to force automatic bond creation

Script completed

Jmol script terminated

Molfile expand

Wikipedia	License
Arachidonic acid (AA, sometimes ARA) is a polyunsaturated omega−6 fatty acid 20:4(ω−6), or 20:4(5,8,11,14). If its precursors or diet contains linoleic acid it is formed by biosynthesis and can be deposited in animal fats. It is a precursor in the formation of leukotrienes, prostaglandins, and thromboxanes. Together with omega−3 fatty acids and other omega−6 fatty acids, arachidonic acid provides energy for body functions, contributes to cell membrane structure, and participates in the synthesis of eicosanoids, which have numerous roles in physiology as signaling molecules. Its name derives from the ancient Greek neologism arachis 'peanut', although peanut oil does not contain any arachidonic acid. Arachidonate is the name of the derived carboxylate anion (conjugate base of the acid), salts, and some esters.
Read full article at Wikipedia

Formula

C20H32O5

Net Charge

Average Mass

352.471

Monoisotopic Mass

352.22497

InChI

InChI=1S/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-17,19,21,23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t15-,16+,17+,19+/m0/s1

InChIKey

XEYBRNLFEZDVAW-ARSRFYASSA-N

SMILES

CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]1C\C=C/CCCC(O)=O

Metabolite of Species	Details
Mus musculus (NCBI:txid10090)	See: MetaboLights Study
Mus musculus (NCBI:txid10090)	Source: BioModels - MODEL1507180067 See: PubMed

Roles Classification
Biological Role(s):	mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens).

Application(s):	oxytocic A drug that stimulates contraction of the myometrium. Oxytocics are used to induce labour, obstetric at term, to prevent or control postpartum or postabortion haemorrhage, and to assess foetal status in high risk pregnancies. They may also be used alone or with other drugs to induce abortions (abortifacients).

View more via ChEBI Ontology

ChEBI Ontology
Outgoing	prostaglandin E₂ (CHEBI:15551) has role human metabolite (CHEBI:77746) prostaglandin E₂ (CHEBI:15551) has role mouse metabolite (CHEBI:75771) prostaglandin E₂ (CHEBI:15551) has role oxytocic (CHEBI:36063) prostaglandin E₂ (CHEBI:15551) is a prostaglandins E (CHEBI:26338) prostaglandin E₂ (CHEBI:15551) is conjugate acid of prostaglandin E₂(1−) (CHEBI:606564)

Incoming	13,14-dihydro-15-oxo-prostaglandin E₂ (CHEBI:15550) has functional parent prostaglandin E₂ (CHEBI:15551) 15-dehydro-prostaglandin E₂ (CHEBI:15547) has functional parent prostaglandin E₂ (CHEBI:15551) 2-[(5Z,13E,15S)-11α,15-dihydroxy-9-oxoprosta-5,13-dien-1-oyl]-sn-glycero-3-phosphocholine (CHEBI:137585) has functional parent prostaglandin E₂ (CHEBI:15551) 2-[(5Z,13E,15S)-11α,15-dihydroxy-9-oxoprosta-5,13-dien-1-oyl]-sn-glycero-3-phosphoethanolamine (CHEBI:138361) has functional parent prostaglandin E₂ (CHEBI:15551) 20-hydroxyprostaglandin E₂ (CHEBI:137370) has functional parent prostaglandin E₂ (CHEBI:15551) 8-epi-prostaglandin E₂ (CHEBI:131888) has functional parent prostaglandin E₂ (CHEBI:15551) nitroproston (CHEBI:142127) has functional parent prostaglandin E₂ (CHEBI:15551) prostaglandin E₂ 1-glyceryl ester (CHEBI:90230) has functional parent prostaglandin E₂ (CHEBI:15551) prostaglandin E₂ 2-glyceryl ester (CHEBI:137172) has functional parent prostaglandin E₂ (CHEBI:15551) prostaglandin E₂(1−) (CHEBI:606564) is conjugate base of prostaglandin E₂ (CHEBI:15551)

IUPAC Name

(5Z,13E,15S)-11α,15-dihydroxy-9-oxoprosta-5,13-dien-1-oic acid

INNs	Sources
dinoprostona	WHO MedNet
dinoprostone	WHO MedNet
dinoprostone	WHO MedNet
dinoprostonum	WHO MedNet

Synonyms	Sources
(15S)-prostaglandin E₂	ChemIDplus
(5Z,11α,13E,15S)-11,15-dihydroxy-9-oxoprosta-5,13-dien-1-oic acid	ChemIDplus
(5Z,13E)-(15S)-11alpha,15-Dihydroxy-9-oxoprost-13-enoate	KEGG COMPOUND
(5Z,13E)-(15S)-11alpha,15-Dihydroxy-9-oxoprosta-5,13-dienoate	KEGG COMPOUND
(E,Z)-(1R,2R,3R)-7-(3-Hydroxy-2-((3S)-(3-hydroxy-1-octenyl))-5-oxocyclopentyl)-5-heptenoic acid	ChemIDplus
(Z)-7-((1R,2R,3R)-3-hydroxy-2-((S,E)-3-hydroxyoct-1-enyl)-5-oxocyclopentyl)hept-5-enoic acid	ChEMBL
Dinoproston	ChemIDplus
PGE₂	ChemIDplus
PGE2	KEGG COMPOUND
Prostaglandin E2	KEGG COMPOUND
U 12062	ChemIDplus
U-12,062	ChemIDplus
U-12062	ChemIDplus

Brand Names	Sources
Cervidil	KEGG DRUG
Cerviprime	ChemIDplus
Cerviprost	ChemIDplus
Enzaprost E	ChemIDplus
Glandin-E2	ChEBI
Minprositin E2	ChemIDplus
Minprostin E2	ChemIDplus
Prepidil	KEGG DRUG
Propess	DrugBank
Prostarmon E	ChemIDplus
Prostenone	ChemIDplus
Prostin	ChemIDplus
Prostin E2	KEGG DRUG

Manual Xrefs	Databases
913	DrugCentral
C00584	KEGG COMPOUND
D00079	KEGG DRUG
DB00917	DrugBank
DE2011969	Patent
FDB022498	FooDB
GB851827	Patent
HMDB0001220	HMDB
LMFA03010003	LIPID MAPS
LSM-42919	LINCS
NL6505799	Patent
P2E	PDBeChem
Prostaglandin_E2	Wikipedia
US3598858	Patent
View more database links

Registry Numbers	Types	Sources
2224724	Beilstein Registry Number	Beilstein
2224724	Reaxys Registry Number	Reaxys
363-24-6	CAS Registry Number	KEGG COMPOUND
363-24-6	CAS Registry Number	ChemIDplus

Citations	Types	Sources
11279302	PubMed citation	Europe PMC
12746806	PubMed citation	Europe PMC
12859290	PubMed citation	Europe PMC
14499495	PubMed citation	Europe PMC
14535055	PubMed citation	Europe PMC
14703707	PubMed citation	Europe PMC
15542928	PubMed citation	Europe PMC
15661432	PubMed citation	Europe PMC
16405508	PubMed citation	Europe PMC
16787416	PubMed citation	Europe PMC
16978535	PubMed citation	Europe PMC
20671299	PubMed citation	Europe PMC
2403792	PubMed citation	Europe PMC
24501112	PubMed citation	Europe PMC
32898608	PubMed citation	Europe PMC
33271839	PubMed citation	Europe PMC
33559528	PubMed citation	Europe PMC
33685091	PubMed citation	Europe PMC
33715333	PubMed citation	Europe PMC
33782420	PubMed citation	Europe PMC
33811074	PubMed citation	Europe PMC
33958485	PubMed citation	Europe PMC
34065827	PubMed citation	Europe PMC
34071686	PubMed citation	Europe PMC
34102274	PubMed citation	Europe PMC
6317292	PubMed citation	Europe PMC
7224729	PubMed citation	Europe PMC
74611	PubMed citation	Europe PMC
7836930	PubMed citation	Europe PMC
9276764	PubMed citation	Europe PMC

Last Modified

09 June 2021

CHEBI:15551 - prostaglandin E2

ChEBI is part of the ELIXIR infrastructure

CHEBI:15551 - prostaglandin E₂